import

2012-09-02 15:24:38 +02:00
commit 5b667b5781
250 changed files with 70477 additions and 0 deletions
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,179 @@
+using System;
+using System.IO;
+using FreeImageAPI;
+using System.Collections.Generic;
+using System.Runtime.Serialization.Formatters.Binary;
+using System.Drawing;
+using System.Drawing.Imaging;
+using System.Runtime.InteropServices;
+
+namespace Sample01
+{
+	class Program
+	{
+		static void Main(string[] args)
+		{
+			// Check if FreeImage.dll is available (can be in %path%).
+			if (!FreeImage.IsAvailable())
+			{
+				Console.WriteLine("FreeImage.dll seems to be missing. Aborting.");
+				return;
+			}
+
+			Sample sample = new Sample();
+			// This example shows the basic loading and saving operations offered by FreeImage.
+			sample.Example01();
+
+			// This example shows a more comfortable way offered by the .NET Wrapper.
+			sample.Example02();
+
+			// This example shows the FreeImage-Errormessage-Callback
+			sample.Example03();
+		}
+	}
+
+	public class Sample
+	{
+		const string fileName = @"Sample.jpg";
+		const string outFileName = @"Sample.tif";
+		FIBITMAP dib = new FIBITMAP();
+		string message = null;
+
+		public void Example01()
+		{
+			if (!File.Exists(fileName))
+			{
+				Console.WriteLine(fileName + " does not exist. Aborting.");
+				return;
+			}
+
+			// Try to unload the bitmap handle (in case it is not null).
+			// Always assert that a handle (like dib) is unloaded before it is reused, because
+			// on unmanaged side there is no garbage collector that will clean up unreferenced
+			// objects.
+			// The following code will produce a memory leak (in case the bitmap is loaded
+			// successfully) because the handle to the first bitmap is lost:
+			//   dib = FreeImage.Load(FREE_IMAGE_FORMAT.FIF_JPEG, fileName, FREE_IMAGE_LOAD_FLAGS.JPEG_ACCURATE);
+			//   dib = FreeImage.Load(FREE_IMAGE_FORMAT.FIF_JPEG, fileName, FREE_IMAGE_LOAD_FLAGS.JPEG_ACCURATE);
+			if (!dib.IsNull)
+				FreeImage.Unload(dib);
+
+			// Loading a sample bitmap. In this case it's a .jpg file. 'Load' requires the file
+			// format or the loading process will fail. An additional flag (the default value is
+			// 'DEFAULT') can be set to enable special loading options.
+			dib = FreeImage.Load(FREE_IMAGE_FORMAT.FIF_JPEG, fileName, FREE_IMAGE_LOAD_FLAGS.JPEG_ACCURATE);
+
+			// Check if the handle is null which means the bitmap could not be loaded.
+			if (dib.IsNull)
+			{
+				Console.WriteLine("Loading bitmap failed. Aborting.");
+				// Check whether there was an error message.
+				return;
+			}
+
+			// Try flipping the bitmap.
+			if (!FreeImage.FlipHorizontal(dib))
+			{
+				Console.WriteLine("Unable to flip bitmap.");
+				// Check whether there was an error message.
+			}
+
+			// Store the bitmap back to disk. Again the desired format is needed. In this case the format is 'TIFF'.
+			// An output filename has to be chosen (which will be overwritten without a warning).
+			// A flag can be provided to enable pluginfunctions (compression is this case).
+			FreeImage.Save(FREE_IMAGE_FORMAT.FIF_TIFF, dib, outFileName, FREE_IMAGE_SAVE_FLAGS.TIFF_DEFLATE);
+
+			// The bitmap was saved to disk but is still allocated in memory, so the handle has to be freed.
+			if (!dib.IsNull)
+				FreeImage.Unload(dib);
+
+			// Make sure to set the handle to null so that it is clear that the handle is not pointing to a bitmap.
+			dib.SetNull();
+		}
+
+		public void Example02()
+		{
+			// 'UnloadEx' is a comfortable way of unloading a bitmap. The coder can call 'UnloadEx' even
+			// when the handle is pointing to null (in this case nothing will happen). In case the handle
+			// is valid (valid means that it is NOT pointing to null) the bitmap will be unloaded and the
+			// handle will be set to null manually.
+			FreeImage.UnloadEx(ref dib);
+
+			// 'LoadEx' is a comfortable way of loading a bitmap. 'LoadEx' tries to find out the format of
+			// the file and will use this to load it. It will use DEFAULT loading values.
+			dib = FreeImage.LoadEx(fileName);
+
+			// Check if the handle is null which means the bitmap could not be loaded.
+			if (dib.IsNull)
+			{
+				Console.WriteLine("Loading bitmap failed. Aborting.");
+				return;
+			}
+
+			// 'SaveEx' (like 'LoadEx') will try to save the bitmap with default values.
+			// Before saving the bitmap, 'SaveEx' checks whether the extension is valid for the file type
+			// and if the plugin can use the colordepth of the bitmap. If not it will automatically convert
+			// the bitmap into the next best colordepth and save it.
+			if (!FreeImage.SaveEx(ref dib, @"Sample.gif", false))
+			{
+				Console.WriteLine("Saving bitmap failed.");
+			}
+
+			// The handle is still valid.
+			if (!FreeImage.SaveEx(
+				ref dib,
+				@"Sample",							// No extension was selected so let 'SaveEx' decide.
+				FREE_IMAGE_FORMAT.FIF_PNG,			// A format is needed this time.
+				FREE_IMAGE_SAVE_FLAGS.DEFAULT,		// PNG has no options so use default.
+				FREE_IMAGE_COLOR_DEPTH.FICD_04_BPP,	// 4bpp as result color depth.
+				true))								// We're done so unload
+			{
+				// SaveEx will not unload the bitmap in case saving failed.
+				// This way possible operations done to the bitmaps aren't lost.
+				FreeImage.UnloadEx(ref dib);
+			}
+		}
+
+		public void Example03()
+		{
+			// Safely unload to prevent memory leak.
+			FreeImage.UnloadEx(ref dib);
+
+			// Load the example bitmap.
+			dib = FreeImage.LoadEx(fileName);
+
+			// Check whether loading succeeded.
+			if (dib.IsNull)
+			{
+				return;
+			}
+
+			// Add this class to the callback event.
+			FreeImageEngine.Message += new OutputMessageFunction(FreeImage_Message);
+
+			// Try to save the bitmap as a gif
+			if (!FreeImage.Save(FREE_IMAGE_FORMAT.FIF_GIF, dib, @"Sample_fail.gif", FREE_IMAGE_SAVE_FLAGS.DEFAULT))
+			{
+				// Saving failed
+				// Check whether there was an error callback
+				if (message != null)
+				{
+					// Print the message and delete it.
+					Console.WriteLine("Error message recieved: {0}", message);
+					message = null;
+				}
+			}
+
+			// Unload bitmap.
+			FreeImage.UnloadEx(ref dib);
+
+			// Remove this class from the callback event.
+			FreeImageEngine.Message -= new OutputMessageFunction(FreeImage_Message);
+		}
+
+		void FreeImage_Message(FREE_IMAGE_FORMAT fif, string message)
+		{
+			this.message = message;
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("ac0569fe-c021-4f40-bfe9-275baf0fd21a")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,103 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{0D294AB6-FAD4-4364-AAB6-43C1796116A9}</ProjectGuid>
+    <OutputType>Exe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample01</RootNamespace>
+    <AssemblyName>Sample01</AssemblyName>
+    <StartupObject>
+    </StartupObject>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <AllowUnsafeBlocks>true</AllowUnsafeBlocks>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <AllowUnsafeBlocks>true</AllowUnsafeBlocks>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <AllowUnsafeBlocks>true</AllowUnsafeBlocks>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <AllowUnsafeBlocks>true</AllowUnsafeBlocks>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <AllowUnsafeBlocks>true</AllowUnsafeBlocks>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <AllowUnsafeBlocks>true</AllowUnsafeBlocks>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Drawing" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="Program.cs" />
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <None Include="Sample.jpg">
+      <CopyToOutputDirectory>Always</CopyToOutputDirectory>
+    </None>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,140 @@
+using System;
+using System.IO;
+using FreeImageAPI;
+
+namespace Sample02
+{
+	class Program
+	{
+		static void Main(string[] args)
+		{
+			// Check if FreeImage.dll is available (can be in %path%).
+			if (!FreeImage.IsAvailable())
+			{
+				Console.WriteLine("FreeImage.dll seems to be missing. Aborting.");
+				return;
+			}
+
+			Sample sample = new Sample();
+			sample.Example();
+		}
+	}
+
+	public class Sample
+	{
+		const string fileName = @"multipaged.tif";
+		FIMULTIBITMAP dib = new FIMULTIBITMAP();
+		Random rand = new Random();
+
+		public void Example()
+		{
+			if (!File.Exists(fileName))
+			{
+				Console.WriteLine("File not found. Aborting.");
+				return;
+			}
+
+			// Load the multipaged bitmap.
+			// 'OpenMultiBitmapEx' tries to find the correct file format, loads the bitmap
+			// with default options, with write support and does not use caching.
+			dib = FreeImage.OpenMultiBitmapEx(fileName);
+
+			// Check whether loading succeeded.
+			if (dib.IsNull)
+			{
+				Console.WriteLine("File could not be loaded. Aborting.");
+				return;
+			}
+
+			// Get the number of bitmaps the multipaged bitmap contains.
+			int count = FreeImage.GetPageCount(dib);
+
+			// Multipaged bitmaps consist of multiple single FIBITMAPs
+			FIBITMAP page = new FIBITMAP();
+
+			// There are bitmaps we can work with.
+			if (count > 0)
+			{
+				// Lock a random bitmap to work with.
+				page = FreeImage.LockPage(dib, rand.Next(0, count));
+			}
+
+			// Check whether locking succeeded.
+			if (page.IsNull)
+			{
+				// Locking failed. Unload the bitmap and return.
+				FreeImage.CloseMultiBitmapEx(ref dib);
+				return;
+			}
+
+			// Get a list of locked pages. This can be usefull to check whether a page has already been locked.
+			int[] lockedPages = FreeImage.GetLockedPages(dib);
+
+			// Lets modify the page.
+			if (FreeImage.AdjustGamma(page, 2d))
+			{
+				Console.WriteLine("Successfully changed gamma of page {0}.", lockedPages[0]);
+			}
+			else
+			{
+				Console.WriteLine("Failed to adjust gamma ...");
+			}
+
+			// Print out the list of locked pages
+			foreach (int i in lockedPages)
+				Console.WriteLine("Page {0} is locked.", i);
+
+			// Use 'UnlockPage' instead of 'Unload' to free the page. Set the third parameter to 'true'
+			// so that FreeImage can store the changed page within the multipaged bitmap.
+			FreeImage.UnlockPage(dib, page, true);
+
+			// Retieve the list again to see whether unlocking succeeded.
+			lockedPages = FreeImage.GetLockedPages(dib);
+
+			// No output should be produced here.
+			foreach (int i in lockedPages)
+				Console.WriteLine("Page {0} is still locked.", i);
+
+			// If there are more than one page we can swap them
+			if (count > 1)
+			{
+				if (!FreeImage.MovePage(dib, 1, 0))
+				{
+					Console.WriteLine("Swapping pages failed.");
+				}
+			}
+
+			if (count > 2)
+			{
+				// Lock page 2
+				page = FreeImage.LockPage(dib, 2);
+				if (!page.IsNull)
+				{
+					// Clone the page for later appending
+					FIBITMAP temp = FreeImage.Clone(page);
+
+					// Unlock the page again
+					FreeImage.UnlockPage(dib, page, false);
+
+					// Delete the page form the multipaged bitmap
+					FreeImage.DeletePage(dib, 2);
+
+					// Append the clone again
+					FreeImage.AppendPage(dib, temp);
+
+					// Check whether the number of pages is still the same
+					Console.WriteLine("Pages before: {0}. Pages after: {1}", count, FreeImage.GetPageCount(dib));
+
+					// Unload clone to prevent memory leak
+					FreeImage.UnloadEx(ref temp);
+				}
+			}
+
+			// We are done and close the multipaged bitmap.
+			if (!FreeImage.CloseMultiBitmapEx(ref dib))
+			{
+				Console.WriteLine("Closing bitmap failed!");
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("35960522-c01a-40d2-a86b-37b9839b131c")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,95 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{AF8B72BD-1A8B-4E6B-A0F1-0BD57497777B}</ProjectGuid>
+    <OutputType>Exe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample02</RootNamespace>
+    <AssemblyName>Sample02</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Drawing" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="Program.cs" />
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <None Include="multipaged.tif">
+      <CopyToOutputDirectory>Always</CopyToOutputDirectory>
+    </None>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,74 @@
+using System;
+using System.IO;
+using FreeImageAPI;
+
+namespace Sample03
+{
+	class Program
+	{
+		static void Main(string[] args)
+		{
+			// Check if FreeImage.dll is available (can be in %path%).
+			if (!FreeImage.IsAvailable())
+			{
+				Console.WriteLine("FreeImage.dll seems to be missing. Aborting.");
+				return;
+			}
+
+			// Add this class to the message event
+			FreeImageEngine.Message += new OutputMessageFunction(FreeImage_Message);
+
+			Sample sample = new Sample();
+			sample.Example();
+
+			// Remove this class from the message event
+			FreeImageEngine.Message -= new OutputMessageFunction(FreeImage_Message);
+		}
+
+		static void FreeImage_Message(FREE_IMAGE_FORMAT fif, string message)
+		{
+			Console.WriteLine("Error for {0}: {1}", fif.ToString(), message);
+		}
+	}
+
+	public class Sample
+	{
+		FIBITMAP dib = new FIBITMAP();
+
+		public void Example()
+		{
+			// Allocating a new bitmap with 99x99 pixels, 16-bit color depth and an allocation of 5 bits for each color.
+			dib = FreeImage.Allocate(99, 99, 16, FreeImage.FI16_555_RED_MASK, FreeImage.FI16_555_GREEN_MASK, FreeImage.FI16_555_BLUE_MASK);
+
+			// Saving bitmap.
+			if (!FreeImage.SaveEx(ref dib, "example01.bmp", true))
+			{
+				Console.WriteLine("Saving 'example.bmp' failed.");
+				FreeImage.UnloadEx(ref dib);
+			}
+
+			// Allocation a new bitmap with 71x33 pixels, 4-bit color depth. Bitmaps below 16-bit have paletts.
+			// Each pixel references an index within the palette wich contains the true color.
+			// Therefor no bit-masks are needed and can be set to 0.
+			dib = FreeImage.Allocate(71, 33, 4, 0, 0, 0);
+
+			// Saving bitmap.
+			if (!FreeImage.SaveEx(ref dib, "example02.tif", true))
+			{
+				Console.WriteLine("Saving 'example02.tif' failed.");
+				FreeImage.UnloadEx(ref dib);
+			}
+
+			// Allocation a new bitmap. This time 'AllocateT' is used because 'Allocate' can only create standard bitmaps.
+			// In this case a RGBF bitmap is created. Red, green and blue are represented by a float-value so no bit-masks are needed.
+			dib = FreeImage.AllocateT(FREE_IMAGE_TYPE.FIT_RGBF, 50, 75, 9, 0, 0, 0);
+
+			// Saving bitmap.
+			if (!FreeImage.SaveEx(ref dib, "example03.hdr", true))
+			{
+				Console.WriteLine("Saving 'example03.hdr' failed.");
+				FreeImage.UnloadEx(ref dib);
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("7139f1dc-3312-4c76-aeb3-891f869409b3")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,89 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{A7E452A1-1A43-47C4-8BF3-DA28E1402FB9}</ProjectGuid>
+    <OutputType>Exe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample03</RootNamespace>
+    <AssemblyName>Sample03</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="Program.cs" />
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,205 @@
+namespace Sample04
+{
+	partial class MainForm
+	{
+		/// <summary>
+		/// Erforderliche Designervariable.
+		/// </summary>
+		private System.ComponentModel.IContainer components = null;
+
+		/// <summary>
+		/// Verwendete Ressourcen bereinigen.
+		/// </summary>
+		/// <param name="disposing">True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False.</param>
+		protected override void Dispose(bool disposing)
+		{
+			if (disposing && (components != null))
+			{
+				components.Dispose();
+			}
+			base.Dispose(disposing);
+		}
+
+		#region Vom Windows Form-Designer generierter Code
+
+		/// <summary>
+		/// Erforderliche Methode für die Designerunterstützung.
+		/// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden.
+		/// </summary>
+		private void InitializeComponent()
+		{
+			this.ofd = new System.Windows.Forms.OpenFileDialog();
+			this.bOpenFile = new System.Windows.Forms.Button();
+			this.lWidth = new System.Windows.Forms.Label();
+			this.lHeight = new System.Windows.Forms.Label();
+			this.lBPP = new System.Windows.Forms.Label();
+			this.lRedMask = new System.Windows.Forms.Label();
+			this.lGreenMask = new System.Windows.Forms.Label();
+			this.lBlueMask = new System.Windows.Forms.Label();
+			this.lImageType = new System.Windows.Forms.Label();
+			this.lDPIY = new System.Windows.Forms.Label();
+			this.lDPIX = new System.Windows.Forms.Label();
+			this.lFormat = new System.Windows.Forms.Label();
+			this.lHeader = new System.Windows.Forms.Label();
+			this.SuspendLayout();
+			// 
+			// ofd
+			// 
+			this.ofd.Filter = "All files (*.*)|*.*";
+			// 
+			// bOpenFile
+			// 
+			this.bOpenFile.Location = new System.Drawing.Point(12, 358);
+			this.bOpenFile.Name = "bOpenFile";
+			this.bOpenFile.Size = new System.Drawing.Size(75, 23);
+			this.bOpenFile.TabIndex = 4;
+			this.bOpenFile.Text = "Open file";
+			this.bOpenFile.UseVisualStyleBackColor = true;
+			this.bOpenFile.Click += new System.EventHandler(this.bOpenFile_Click);
+			// 
+			// lWidth
+			// 
+			this.lWidth.AutoSize = true;
+			this.lWidth.Location = new System.Drawing.Point(9, 51);
+			this.lWidth.Name = "lWidth";
+			this.lWidth.Size = new System.Drawing.Size(46, 16);
+			this.lWidth.TabIndex = 0;
+			this.lWidth.Text = "Width:";
+			// 
+			// lHeight
+			// 
+			this.lHeight.AutoSize = true;
+			this.lHeight.Location = new System.Drawing.Point(9, 76);
+			this.lHeight.Name = "lHeight";
+			this.lHeight.Size = new System.Drawing.Size(53, 16);
+			this.lHeight.TabIndex = 1;
+			this.lHeight.Text = "Height: ";
+			// 
+			// lBPP
+			// 
+			this.lBPP.AutoSize = true;
+			this.lBPP.Location = new System.Drawing.Point(9, 101);
+			this.lBPP.Name = "lBPP";
+			this.lBPP.Size = new System.Drawing.Size(80, 16);
+			this.lBPP.TabIndex = 2;
+			this.lBPP.Text = "Color Depth:";
+			// 
+			// lRedMask
+			// 
+			this.lRedMask.AutoSize = true;
+			this.lRedMask.Location = new System.Drawing.Point(9, 129);
+			this.lRedMask.Name = "lRedMask";
+			this.lRedMask.Size = new System.Drawing.Size(68, 16);
+			this.lRedMask.TabIndex = 3;
+			this.lRedMask.Text = "Red Mask:";
+			// 
+			// lGreenMask
+			// 
+			this.lGreenMask.AutoSize = true;
+			this.lGreenMask.Location = new System.Drawing.Point(9, 188);
+			this.lGreenMask.Name = "lGreenMask";
+			this.lGreenMask.Size = new System.Drawing.Size(80, 16);
+			this.lGreenMask.TabIndex = 5;
+			this.lGreenMask.Text = "Green Mask:";
+			// 
+			// lBlueMask
+			// 
+			this.lBlueMask.AutoSize = true;
+			this.lBlueMask.Location = new System.Drawing.Point(9, 158);
+			this.lBlueMask.Name = "lBlueMask";
+			this.lBlueMask.Size = new System.Drawing.Size(70, 16);
+			this.lBlueMask.TabIndex = 6;
+			this.lBlueMask.Text = "Blue Mask:";
+			// 
+			// lImageType
+			// 
+			this.lImageType.AutoSize = true;
+			this.lImageType.Location = new System.Drawing.Point(9, 215);
+			this.lImageType.Name = "lImageType";
+			this.lImageType.Size = new System.Drawing.Size(81, 16);
+			this.lImageType.TabIndex = 7;
+			this.lImageType.Text = "Image Type:";
+			// 
+			// lDPIY
+			// 
+			this.lDPIY.AutoSize = true;
+			this.lDPIY.Location = new System.Drawing.Point(9, 244);
+			this.lDPIY.Name = "lDPIY";
+			this.lDPIY.Size = new System.Drawing.Size(43, 16);
+			this.lDPIY.TabIndex = 8;
+			this.lDPIY.Text = "DPI Y:";
+			// 
+			// lDPIX
+			// 
+			this.lDPIX.AutoSize = true;
+			this.lDPIX.Location = new System.Drawing.Point(9, 273);
+			this.lDPIX.Name = "lDPIX";
+			this.lDPIX.Size = new System.Drawing.Size(44, 16);
+			this.lDPIX.TabIndex = 9;
+			this.lDPIX.Text = "DPI X:";
+			// 
+			// lFormat
+			// 
+			this.lFormat.AutoSize = true;
+			this.lFormat.Location = new System.Drawing.Point(9, 302);
+			this.lFormat.Name = "lFormat";
+			this.lFormat.Size = new System.Drawing.Size(78, 16);
+			this.lFormat.TabIndex = 10;
+			this.lFormat.Text = "File Format:";
+			// 
+			// lHeader
+			// 
+			this.lHeader.AutoSize = true;
+			this.lHeader.Location = new System.Drawing.Point(117, 19);
+			this.lHeader.Name = "lHeader";
+			this.lHeader.Size = new System.Drawing.Size(162, 16);
+			this.lHeader.TabIndex = 11;
+			this.lHeader.Text = "Bitmap-Information Viewer";
+			// 
+			// MainForm
+			// 
+			this.AutoScaleDimensions = new System.Drawing.SizeF(7F, 16F);
+			this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
+			this.ClientSize = new System.Drawing.Size(400, 393);
+			this.Controls.Add(this.lHeader);
+			this.Controls.Add(this.lFormat);
+			this.Controls.Add(this.lDPIX);
+			this.Controls.Add(this.lDPIY);
+			this.Controls.Add(this.lImageType);
+			this.Controls.Add(this.lBlueMask);
+			this.Controls.Add(this.lGreenMask);
+			this.Controls.Add(this.bOpenFile);
+			this.Controls.Add(this.lRedMask);
+			this.Controls.Add(this.lBPP);
+			this.Controls.Add(this.lHeight);
+			this.Controls.Add(this.lWidth);
+			this.Font = new System.Drawing.Font("Tahoma", 9.75F, System.Drawing.FontStyle.Regular, System.Drawing.GraphicsUnit.Point, ((byte)(0)));
+			this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
+			this.Margin = new System.Windows.Forms.Padding(3, 4, 3, 4);
+			this.MaximizeBox = false;
+			this.MinimizeBox = false;
+			this.Name = "MainForm";
+			this.StartPosition = System.Windows.Forms.FormStartPosition.CenterScreen;
+			this.Text = "Sample04";
+			this.ResumeLayout(false);
+			this.PerformLayout();
+
+		}
+
+		#endregion
+
+		private System.Windows.Forms.OpenFileDialog ofd;
+		private System.Windows.Forms.Button bOpenFile;
+		private System.Windows.Forms.Label lWidth;
+		private System.Windows.Forms.Label lHeight;
+		private System.Windows.Forms.Label lBPP;
+		private System.Windows.Forms.Label lRedMask;
+		private System.Windows.Forms.Label lGreenMask;
+		private System.Windows.Forms.Label lBlueMask;
+		private System.Windows.Forms.Label lImageType;
+		private System.Windows.Forms.Label lDPIY;
+		private System.Windows.Forms.Label lDPIX;
+		private System.Windows.Forms.Label lFormat;
+		private System.Windows.Forms.Label lHeader;
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,120 @@
+using System;
+using System.Windows.Forms;
+using FreeImageAPI;
+
+namespace Sample04
+{
+	public partial class MainForm : Form
+	{
+		string message = null;
+
+		[STAThread]
+		static void Main()
+		{
+			Application.EnableVisualStyles();
+			Application.SetCompatibleTextRenderingDefault(false);
+			Application.Run(new MainForm());
+		}
+
+		public MainForm()
+		{
+			InitializeComponent();
+			FreeImageEngine.Message += new OutputMessageFunction(FreeImage_Message);
+		}
+
+		~MainForm()
+		{
+			FreeImageEngine.Message -= new OutputMessageFunction(FreeImage_Message);
+		}
+
+		void FreeImage_Message(FREE_IMAGE_FORMAT fif, string message)
+		{
+			if (this.message == null)
+			{
+				this.message = message;
+			}
+			else
+			{
+				this.message += "\n" + message;
+			}
+		}
+
+		private void bOpenFile_Click(object sender, EventArgs e)
+		{
+			// Resetting filename
+			ofd.FileName = "";
+
+			// Was a file selected
+			if (ofd.ShowDialog() == DialogResult.OK)
+			{
+				// Format is stored in 'format' on successfull load.
+				FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
+
+				// Try loading the file
+				FIBITMAP dib = FreeImage.LoadEx(ofd.FileName, ref format);
+
+				try
+				{
+					// Error handling
+					if (dib.IsNull)
+					{
+						// Chech whether FreeImage generated an error messe
+						if (message != null)
+						{
+							MessageBox.Show("File could not be loaded!\nError:{0}", message);
+						}
+						else
+						{
+							MessageBox.Show("File could not be loaded!", message);
+						}
+						return;
+					}
+					
+					// Read width
+					lWidth.Text = String.Format("Width: {0}", FreeImage.GetWidth(dib));
+					
+					// Read height
+					lHeight.Text = String.Format("Width: {0}", FreeImage.GetWidth(dib));
+					
+					// Read color depth
+					lBPP.Text = String.Format("Color Depth: {0}", FreeImage.GetBPP(dib));
+					
+					// Read red bitmask (16 - 32 bpp)
+					lRedMask.Text = String.Format("Red Mask: 0x{0:X8}", FreeImage.GetRedMask(dib));
+
+					// Read green bitmask (16 - 32 bpp)
+					lBlueMask.Text = String.Format("Green Mask: 0x{0:X8}", FreeImage.GetGreenMask(dib));
+
+					// Read blue bitmask (16 - 32 bpp)
+					lGreenMask.Text = String.Format("Blue Mask: 0x{0:X8}", FreeImage.GetBlueMask(dib));
+
+					// Read image type (FI_BITMAP, FIT_RGB16, FIT_COMPLEX ect)
+					lImageType.Text = String.Format("Image Type: {0}", FreeImage.GetImageType(dib));
+					
+					// Read x-axis dpi
+					lDPIX.Text = String.Format("DPI X: {0}", FreeImage.GetResolutionX(dib));
+					
+					// Read y-axis dpi
+					lDPIY.Text = String.Format("DPI Y: {0}", FreeImage.GetResolutionY(dib));
+					
+					// Read file format
+					lFormat.Text = String.Format("File Format: {0}", FreeImage.GetFormatFromFIF(format));
+				}
+				catch
+				{
+				}
+				
+				// Always unload bitmap
+				FreeImage.UnloadEx(ref dib);
+				
+				// Reset the error massage buffer
+				message = null;
+			}
+			// No file was selected
+			else
+			{
+				MessageBox.Show("No file loaded.", "Error");
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,123 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <!-- 
+    Microsoft ResX Schema 
+    
+    Version 2.0
+    
+    The primary goals of this format is to allow a simple XML format 
+    that is mostly human readable. The generation and parsing of the 
+    various data types are done through the TypeConverter classes 
+    associated with the data types.
+    
+    Example:
+    
+    ... ado.net/XML headers & schema ...
+    <resheader name="resmimetype">text/microsoft-resx</resheader>
+    <resheader name="version">2.0</resheader>
+    <resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
+    <resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
+    <data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
+    <data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
+    <data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
+        <value>[base64 mime encoded serialized .NET Framework object]</value>
+    </data>
+    <data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
+        <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
+        <comment>This is a comment</comment>
+    </data>
+                
+    There are any number of "resheader" rows that contain simple 
+    name/value pairs.
+    
+    Each data row contains a name, and value. The row also contains a 
+    type or mimetype. Type corresponds to a .NET class that support 
+    text/value conversion through the TypeConverter architecture. 
+    Classes that don't support this are serialized and stored with the 
+    mimetype set.
+    
+    The mimetype is used for serialized objects, and tells the 
+    ResXResourceReader how to depersist the object. This is currently not 
+    extensible. For a given mimetype the value must be set accordingly:
+    
+    Note - application/x-microsoft.net.object.binary.base64 is the format 
+    that the ResXResourceWriter will generate, however the reader can 
+    read any of the formats listed below.
+    
+    mimetype: application/x-microsoft.net.object.binary.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
+            : and then encoded with base64 encoding.
+    
+    mimetype: application/x-microsoft.net.object.soap.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
+            : and then encoded with base64 encoding.
+
+    mimetype: application/x-microsoft.net.object.bytearray.base64
+    value   : The object must be serialized into a byte array 
+            : using a System.ComponentModel.TypeConverter
+            : and then encoded with base64 encoding.
+    -->
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
+              <xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
+              <xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <metadata name="ofd.TrayLocation" type="System.Drawing.Point, System.Drawing, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b03f5f7f11d50a3a">
+    <value>17, 17</value>
+  </metadata>
+</root>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("7c8fdc9a-a8f9-4996-99c8-9df47513edeb")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,102 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{1F4BCDD7-5BD9-4237-8B14-C52B2A9FF52A}</ProjectGuid>
+    <OutputType>WinExe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample04</RootNamespace>
+    <AssemblyName>Sample04</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Drawing" />
+    <Reference Include="System.Windows.Forms" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="MainForm.cs">
+      <SubType>Form</SubType>
+    </Compile>
+    <Compile Include="MainForm.Designer.cs">
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </Compile>
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <EmbeddedResource Include="MainForm.resx">
+      <SubType>Designer</SubType>
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </EmbeddedResource>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,213 @@
+using System;
+using FreeImageAPI;
+using System.Drawing;
+
+namespace Sample05
+{
+	class Program
+	{
+		static void Main(string[] args)
+		{
+			// Check if FreeImage.dll is available (can be in %path%).
+			if (!FreeImage.IsAvailable())
+			{
+				Console.WriteLine("FreeImage.dll seems to be missing. Aborting.");
+				return;
+			}
+
+			Sample sample = new Sample();
+
+			// The example will flip the bitmap by manually accessing the
+			// bitmaps scanlines and swapping them
+			sample.Example01();
+
+			// The example will access each pixel of the bitmap manually
+			// and change its color intensity to 3/4 of the original value
+			// which will have a darker bitmap as result.
+			sample.Example02();
+
+			// The example will access and swap the bitmaps palette from
+			// 'FIC_MINISBLACK' to 'FIC_MINISWHITE'. Then it will swap each pixels
+			// palette index so that each pixel is assigned to the its old value
+			// so that the bitmaps "pixeldata" stays the same.
+			sample.Example03();
+		}
+	}
+
+	public class Sample
+	{
+		FIBITMAP dib = new FIBITMAP();
+
+		public void Example01()
+		{
+			// Load sample file
+			dib = FreeImage.LoadEx("Sample.jpg", FREE_IMAGE_LOAD_FLAGS.JPEG_ACCURATE);
+
+			// Check whether loading succeeded
+			if (dib.IsNull)
+			{
+				Console.WriteLine("Sample.jpg could not be loaded. Aborting.");
+				return;
+			}
+
+			// Check whether the bitmap has 24 bpp color depth to ensure
+			// using RGBTRIPPLE is correct.
+			if (FreeImage.GetBPP(dib) != 24)
+			{
+				Console.WriteLine("Sample.jpg is no 24 bpp bitmap. Aborting.");
+				FreeImage.UnloadEx(ref dib);
+				return;
+			}
+
+			// Store height of the bitmap
+			int height = (int)FreeImage.GetHeight(dib);
+
+			// Iterate over half of the bitmaps scanlines and swap
+			// line[1] with line[height], line[2] with line[height-1] etc which will
+			// flip the image.
+			for (int i = 0; i < (height / 2); i++)
+			{
+				// Get scanline from the bottom part of the bitmap
+				Scanline<RGBTRIPLE> scanlineBottom = new Scanline<RGBTRIPLE>(dib, i);
+
+				// Get scanline from the top part of the bitmap
+				Scanline<RGBTRIPLE> scanlineTop = new Scanline<RGBTRIPLE>(dib, height - 1 - i);
+
+				// Get arrays of RGBTRIPPLEs that contain the bitmaps real pixel data
+				// of the two scanlines.
+				RGBTRIPLE[] rgbtBottom = scanlineBottom.Data;
+				RGBTRIPLE[] rgbtTop = scanlineTop.Data;
+
+				// Restore the scanline across to switch the bitmaps lines.
+				scanlineBottom.Data = rgbtTop;
+				scanlineTop.Data = rgbtBottom;
+			}
+
+			// Store the bitmap to disk
+			if (!FreeImage.SaveEx(ref dib, "SampleOut01.jpg", FREE_IMAGE_SAVE_FLAGS.JPEG_QUALITYGOOD, true))
+			{
+				Console.WriteLine("Error while saving 'SampleOut01.jpg'");
+				FreeImage.UnloadEx(ref dib);
+			}
+		}
+
+		public void Example02()
+		{
+			dib = FreeImage.LoadEx("Sample.jpg", FREE_IMAGE_LOAD_FLAGS.JPEG_ACCURATE);
+
+			// Check whether loading succeeded
+			if (dib.IsNull)
+			{
+				Console.WriteLine("Sample.jpg could not be loaded. Aborting.");
+				return;
+			}
+
+			// Check whether the bitmap has 24 bpp color depth to ensure
+			// using RGBTRIPPLE is correct.
+			if (FreeImage.GetBPP(dib) != 24)
+			{
+				Console.WriteLine("Sample.jpg is no 24 bpp bitmap. Aborting.");
+				FreeImage.UnloadEx(ref dib);
+				return;
+			}
+
+			// Iterate over all scanlines
+			for (int i = 0; i < FreeImage.GetHeight(dib); i++)
+			{
+				// Get scanline
+				Scanline<RGBTRIPLE> scanline = new Scanline<RGBTRIPLE>(dib, i);
+
+				// Get pixeldata from scanline
+				RGBTRIPLE[] rgbt = scanline.Data;
+
+				// Iterate over each pixel reducing the colors intensity to 3/4 which
+				// will darken the bitmap.
+				for (int j = 0; j < rgbt.Length; j++)
+				{
+					rgbt[j].rgbtBlue = (byte)((int)rgbt[j].rgbtBlue * 3 / 4);
+					rgbt[j].rgbtGreen = (byte)((int)rgbt[j].rgbtGreen * 3 / 4);
+					rgbt[j].rgbtRed = (byte)((int)rgbt[j].rgbtRed * 3 / 4);
+
+					// In case no direct access to the data is implemented
+					// the following way is equivalent:
+					//
+					// Color color = rgbt[j].color;
+					// rgbt[j].color = Color.FromArgb(color.R * 3 / 4, color.G * 3 / 4, color.B * 3 / 4);
+				}
+
+				// Write the darkened scanline back to memory
+				scanline.Data = rgbt;
+			}
+
+			// Store the bitmap to disk
+			if (!FreeImage.SaveEx(ref dib, "SampleOut02.jpg", FREE_IMAGE_SAVE_FLAGS.JPEG_QUALITYGOOD, true))
+			{
+				Console.WriteLine("Error while saving 'SampleOut02.jpg'");
+				FreeImage.UnloadEx(ref dib);
+			}
+		}
+
+		public void Example03()
+		{
+			dib = FreeImage.LoadEx("Sample.tif");
+
+			// Check whether loading succeeded
+			if (dib.IsNull)
+			{
+				Console.WriteLine("Sample.tif could not be loaded. Aborting.");
+				return;
+			}
+
+			// Check whether the bitmap has 4 bpp color depth to ensure
+			// using FI4B is correct.
+			if (FreeImage.GetBPP(dib) != 4)
+			{
+				Console.WriteLine("Sample.tif is no 4 bpp bitmap. Aborting.");
+				FreeImage.UnloadEx(ref dib);
+				return;
+			}
+
+			// Get the bitmaps palette
+			Palette palette = FreeImage.GetPaletteEx(dib);
+
+			int size = (int)palette.Length;
+
+			// Check whether the palette has a color (is valid)
+			if (size == 0)
+			{
+				Console.WriteLine("Sample.tif has no valid palette. Aborting.");
+				FreeImage.UnloadEx(ref dib);
+				return;
+			}
+
+			// Swapping the palette
+			for (int i = 0; i < size / 2; i++)
+			{
+				RGBQUAD temp = palette[i];
+				palette[i] = palette[size - 1 - i];
+				palette[size - 1 - i] = temp;
+			}
+
+			// Iterate over each scanline
+			for (int i = 0; i < FreeImage.GetHeight(dib); i++)
+			{
+				// Get scanline
+				Scanline<FI4BIT> scanline = new Scanline<FI4BIT>(dib, i);
+
+				// Iterate over all pixels swapping the palette index
+				// so that the color will stay the same
+				for (int j = 0; j < scanline.Length; j++)
+				{
+					scanline[j] = (byte)(size - 1 - scanline[j]);
+				}
+			}
+
+			// Save the bitmap to disk
+			if (!FreeImage.SaveEx(ref dib, "SampleOut03.tif", FREE_IMAGE_SAVE_FLAGS.TIFF_LZW, true))
+			{
+				Console.WriteLine("Error while saving 'SampleOut03.tif'");
+				FreeImage.UnloadEx(ref dib);
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("fd43331d-5ea4-40f8-86d5-8f820d606912")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,98 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{A501F134-8FB6-460B-AFE9-884A696C1C07}</ProjectGuid>
+    <OutputType>Exe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample05</RootNamespace>
+    <AssemblyName>Sample05</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Compile Include="Program.cs" />
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Drawing" />
+  </ItemGroup>
+  <ItemGroup>
+    <None Include="Sample.jpg">
+      <CopyToOutputDirectory>Always</CopyToOutputDirectory>
+    </None>
+    <None Include="Sample.tif">
+      <CopyToOutputDirectory>Always</CopyToOutputDirectory>
+    </None>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,120 @@
+namespace Sample06
+{
+	partial class MainForm
+	{
+		/// <summary>
+		/// Erforderliche Designervariable.
+		/// </summary>
+		private System.ComponentModel.IContainer components = null;
+
+		/// <summary>
+		/// Verwendete Ressourcen bereinigen.
+		/// </summary>
+		/// <param name="disposing">True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False.</param>
+		protected override void Dispose(bool disposing)
+		{
+			if (disposing && (components != null))
+			{
+				components.Dispose();
+			}
+			base.Dispose(disposing);
+		}
+
+		#region Vom Windows Form-Designer generierter Code
+
+		/// <summary>
+		/// Erforderliche Methode für die Designerunterstützung.
+		/// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden.
+		/// </summary>
+		private void InitializeComponent()
+		{
+			this.picBox = new System.Windows.Forms.PictureBox();
+			this.bExample01 = new System.Windows.Forms.Button();
+			this.bOriginal = new System.Windows.Forms.Button();
+			this.bExample02 = new System.Windows.Forms.Button();
+			this.bExample03 = new System.Windows.Forms.Button();
+			((System.ComponentModel.ISupportInitialize)(this.picBox)).BeginInit();
+			this.SuspendLayout();
+			// 
+			// picBox
+			// 
+			this.picBox.BackColor = System.Drawing.Color.White;
+			this.picBox.BorderStyle = System.Windows.Forms.BorderStyle.FixedSingle;
+			this.picBox.Location = new System.Drawing.Point(12, 12);
+			this.picBox.Name = "picBox";
+			this.picBox.Size = new System.Drawing.Size(747, 465);
+			this.picBox.TabIndex = 0;
+			this.picBox.TabStop = false;
+			// 
+			// bExample01
+			// 
+			this.bExample01.Location = new System.Drawing.Point(93, 483);
+			this.bExample01.Name = "bExample01";
+			this.bExample01.Size = new System.Drawing.Size(88, 23);
+			this.bExample01.TabIndex = 1;
+			this.bExample01.Text = "Example 01";
+			this.bExample01.UseVisualStyleBackColor = true;
+			this.bExample01.Click += new System.EventHandler(this.bExample01_Click);
+			// 
+			// bOriginal
+			// 
+			this.bOriginal.Location = new System.Drawing.Point(12, 483);
+			this.bOriginal.Name = "bOriginal";
+			this.bOriginal.Size = new System.Drawing.Size(75, 23);
+			this.bOriginal.TabIndex = 2;
+			this.bOriginal.Text = "Original";
+			this.bOriginal.UseVisualStyleBackColor = true;
+			this.bOriginal.Click += new System.EventHandler(this.bOriginal_Click);
+			// 
+			// bExample02
+			// 
+			this.bExample02.Location = new System.Drawing.Point(187, 483);
+			this.bExample02.Name = "bExample02";
+			this.bExample02.Size = new System.Drawing.Size(88, 23);
+			this.bExample02.TabIndex = 3;
+			this.bExample02.Text = "Example 02";
+			this.bExample02.UseVisualStyleBackColor = true;
+			this.bExample02.Click += new System.EventHandler(this.bExample02_Click);
+			// 
+			// bExample03
+			// 
+			this.bExample03.Location = new System.Drawing.Point(281, 483);
+			this.bExample03.Name = "bExample03";
+			this.bExample03.Size = new System.Drawing.Size(88, 23);
+			this.bExample03.TabIndex = 4;
+			this.bExample03.Text = "Example 03";
+			this.bExample03.UseVisualStyleBackColor = true;
+			this.bExample03.Click += new System.EventHandler(this.bExample03_Click);
+			// 
+			// MainForm
+			// 
+			this.AutoScaleDimensions = new System.Drawing.SizeF(7F, 16F);
+			this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
+			this.ClientSize = new System.Drawing.Size(771, 518);
+			this.Controls.Add(this.bExample03);
+			this.Controls.Add(this.bExample02);
+			this.Controls.Add(this.bOriginal);
+			this.Controls.Add(this.bExample01);
+			this.Controls.Add(this.picBox);
+			this.Font = new System.Drawing.Font("Tahoma", 9.75F, System.Drawing.FontStyle.Regular, System.Drawing.GraphicsUnit.Point, ((byte)(0)));
+			this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
+			this.Margin = new System.Windows.Forms.Padding(3, 4, 3, 4);
+			this.MaximizeBox = false;
+			this.MinimizeBox = false;
+			this.Name = "MainForm";
+			this.StartPosition = System.Windows.Forms.FormStartPosition.CenterScreen;
+			this.Text = "Sample06";
+			((System.ComponentModel.ISupportInitialize)(this.picBox)).EndInit();
+			this.ResumeLayout(false);
+
+		}
+
+		#endregion
+
+		private System.Windows.Forms.PictureBox picBox;
+		private System.Windows.Forms.Button bExample01;
+		private System.Windows.Forms.Button bOriginal;
+		private System.Windows.Forms.Button bExample02;
+		private System.Windows.Forms.Button bExample03;
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,177 @@
+using System;
+using System.Drawing;
+using System.Windows.Forms;
+using FreeImageAPI;
+using System.Drawing.Imaging;
+
+namespace Sample06
+{
+	public partial class MainForm : Form
+	{
+		[STAThread]
+		static void Main()
+		{
+			Application.EnableVisualStyles();
+			Application.SetCompatibleTextRenderingDefault(false);
+			Application.Run(new MainForm());
+		}
+
+		public MainForm()
+		{
+			InitializeComponent();
+		}
+
+		private void bExample01_Click(object sender, EventArgs e)
+		{
+			// Load bitmap
+			FIBITMAP dib = FreeImage.LoadEx("Sample.jpg");
+
+			// Check success
+			if (dib.IsNull)
+			{
+				MessageBox.Show("Could not load Sample.jpg", "Error");
+				return;
+			}
+
+			// Check whether bitmap is 24-bit
+			if (FreeImage.GetBPP(dib) != 24)
+			{
+				MessageBox.Show("Sample.jpg is not 24-bit.", "Error");
+				FreeImage.UnloadEx(ref dib);
+				return;
+			}
+
+			// Convert the 24-bit bitmap to 8-bit and forcing the result will be greyscale
+			dib = FreeImage.ConvertColorDepth(dib, FREE_IMAGE_COLOR_DEPTH.FICD_08_BPP | FREE_IMAGE_COLOR_DEPTH.FICD_FORCE_GREYSCALE, true);
+
+			if (FreeImage.GetBPP(dib) == 8)
+			{
+				// Convert the FreeImage-Bitmap into a .NET bitmap
+				Bitmap bitmap = FreeImage.GetBitmap(dib);
+
+				// Dispose the bitmap of the pictureBox
+				if (picBox.Image != null)
+				{
+					picBox.Image.Dispose();
+				}
+
+				// Assign the bitmap to the picturebox
+				picBox.Image = bitmap;
+			}
+
+			// Unload source bitmap
+			FreeImage.UnloadEx(ref dib);
+		}
+
+		private void bOriginal_Click(object sender, EventArgs e)
+		{
+			// Load bitmap
+			FIBITMAP dib = FreeImage.LoadEx("Sample.jpg");
+
+			// Check success
+			if (dib.IsNull)
+			{
+				MessageBox.Show("Could not load Sample.jpg", "Error");
+				return;
+			}
+
+			// Convert the FreeImage-Bitmap into a .NET bitmap
+			Bitmap bitmap = FreeImage.GetBitmap(dib);
+
+			// Check success
+			if (bitmap != null)
+			{
+				// Dispose old bitmap
+				if (picBox.Image != null)
+				{
+					picBox.Image.Dispose();
+				}
+
+				// Assign new bitmap
+				picBox.Image = bitmap;
+			}
+
+			// Unload bitmap
+			FreeImage.UnloadEx(ref dib);
+		}
+
+		private void bExample02_Click(object sender, EventArgs e)
+		{
+			FIBITMAP dib = FreeImage.LoadEx("Sample.jpg");
+
+			// Check success
+			if (dib.IsNull)
+			{
+				MessageBox.Show("Could not load Sample.jpg", "Error");
+				return;
+			}
+
+			// Convert bitmap to 8 bit
+			dib = FreeImage.ConvertColorDepth(dib, FREE_IMAGE_COLOR_DEPTH.FICD_08_BPP, true);
+
+			// Check whether conversion succeeded
+			if (FreeImage.GetBPP(dib) != 8)
+			{
+				MessageBox.Show("Converting Sample.jpg to 8-bit failed.", "Error");
+				FreeImage.UnloadEx(ref dib);
+				return;
+			}
+
+			// Convert the FreeImage-Bitmap into a .NET bitmap
+			Bitmap bitmap = FreeImage.GetBitmap(dib);
+
+			// Dispose old bitmap
+			if (picBox.Image != null)
+			{
+				picBox.Image.Dispose();
+			}
+
+			// Assign new bitmap
+			picBox.Image = bitmap;
+
+			// Unload bitmap
+			FreeImage.UnloadEx(ref dib);
+		}
+
+		private void bExample03_Click(object sender, EventArgs e)
+		{
+			// Load bitmap
+			Bitmap bitmap = (Bitmap)Bitmap.FromFile("Sample.jpg");
+
+			// Convert the .NET bitmap into a FreeImage-Bitmap
+			FIBITMAP dib = FreeImage.CreateFromBitmap(bitmap);
+
+			// Unload bitmap
+			bitmap.Dispose();
+
+			// Rescale the bitmap
+			FIBITMAP temp = FreeImage.Rescale(dib, 300, 300, FREE_IMAGE_FILTER.FILTER_BICUBIC);
+
+			// Unload bitmap
+			FreeImage.UnloadEx(ref dib);
+
+			Random rand = new Random();
+
+			// Rotate the bitmap
+			dib = FreeImage.Rotate(temp, rand.NextDouble() * 360d);
+
+			// Unload bitmap
+			FreeImage.UnloadEx(ref temp);
+
+			// Convert the FreeImage-Bitmap into a .NET bitmap
+			bitmap = FreeImage.GetBitmap(dib);
+
+			// Unload bitmap
+			FreeImage.UnloadEx(ref dib);
+
+			// Unload bitmap
+			if (picBox.Image != null)
+			{
+				picBox.Image.Dispose();
+			}
+
+			// Assign new bitmap
+			picBox.Image = bitmap;
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,120 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <!-- 
+    Microsoft ResX Schema 
+    
+    Version 2.0
+    
+    The primary goals of this format is to allow a simple XML format 
+    that is mostly human readable. The generation and parsing of the 
+    various data types are done through the TypeConverter classes 
+    associated with the data types.
+    
+    Example:
+    
+    ... ado.net/XML headers & schema ...
+    <resheader name="resmimetype">text/microsoft-resx</resheader>
+    <resheader name="version">2.0</resheader>
+    <resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
+    <resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
+    <data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
+    <data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
+    <data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
+        <value>[base64 mime encoded serialized .NET Framework object]</value>
+    </data>
+    <data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
+        <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
+        <comment>This is a comment</comment>
+    </data>
+                
+    There are any number of "resheader" rows that contain simple 
+    name/value pairs.
+    
+    Each data row contains a name, and value. The row also contains a 
+    type or mimetype. Type corresponds to a .NET class that support 
+    text/value conversion through the TypeConverter architecture. 
+    Classes that don't support this are serialized and stored with the 
+    mimetype set.
+    
+    The mimetype is used for serialized objects, and tells the 
+    ResXResourceReader how to depersist the object. This is currently not 
+    extensible. For a given mimetype the value must be set accordingly:
+    
+    Note - application/x-microsoft.net.object.binary.base64 is the format 
+    that the ResXResourceWriter will generate, however the reader can 
+    read any of the formats listed below.
+    
+    mimetype: application/x-microsoft.net.object.binary.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
+            : and then encoded with base64 encoding.
+    
+    mimetype: application/x-microsoft.net.object.soap.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
+            : and then encoded with base64 encoding.
+
+    mimetype: application/x-microsoft.net.object.bytearray.base64
+    value   : The object must be serialized into a byte array 
+            : using a System.ComponentModel.TypeConverter
+            : and then encoded with base64 encoding.
+    -->
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
+              <xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
+              <xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+</root>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("69a8cbdd-43da-49e3-8d0b-2680c4ca2851")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,107 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{E2EA945D-E22C-47B3-9DD9-3A0B07FA3F81}</ProjectGuid>
+    <OutputType>WinExe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample06</RootNamespace>
+    <AssemblyName>Sample06</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Drawing" />
+    <Reference Include="System.Windows.Forms" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="MainForm.cs">
+      <SubType>Form</SubType>
+    </Compile>
+    <Compile Include="MainForm.Designer.cs">
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </Compile>
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <EmbeddedResource Include="MainForm.resx">
+      <SubType>Designer</SubType>
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </EmbeddedResource>
+  </ItemGroup>
+  <ItemGroup>
+    <None Include="Sample.jpg">
+      <CopyToOutputDirectory>Always</CopyToOutputDirectory>
+    </None>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,73 @@
+using System;
+using System.Collections.Generic;
+using FreeImageAPI;
+
+namespace Sample07
+{
+	class Program
+	{
+		static void Main(string[] args)
+		{
+			// Check if FreeImage.dll is available (can be in %path%).
+			if (!FreeImage.IsAvailable())
+			{
+				Console.WriteLine("FreeImage.dll seems to be missing. Aborting.");
+				return;
+			}
+
+			Sample sample = new Sample();
+			// This example shows how to work with ICC-Profiles.
+			sample.Example();
+		}
+	}
+
+	public class Sample
+	{
+		public void Example()
+		{
+			// Load the sample bitmap.
+			FIBITMAP dib = FreeImage.LoadEx("Sample.jpg");
+
+			// Check success
+			if (dib.IsNull)
+			{
+				Console.WriteLine("Sample.jpg could not be loaded. Aborting.");
+				return;
+			}
+
+			// Get the bitmaps ICC-Profile.
+			FIICCPROFILE icc = FreeImage.GetICCProfileEx(dib);
+
+			// Print the profiles address.
+			Console.WriteLine("The profiles memory-address is : 0x{0}", icc.DataPointer.ToString("X"));
+
+			// Print the profiles size
+			Console.WriteLine("The profiles size is : {0} bytes", icc.Size);
+
+			// Create data for a new profile.
+			byte[] data = new byte[256];
+			for (int i = 0; i < data.Length; i++)
+				data[i] = (byte)i;
+
+			// Create the new profile
+			icc = new FIICCPROFILE(dib, data);
+
+			Console.WriteLine("The profiles memory-address is : 0x{0}", icc.DataPointer.ToString("X"));
+			Console.WriteLine("The profiles size is : {0} bytes", icc.Size);
+
+			// Create the new profile but only use the first 64 bytes
+			icc = new FIICCPROFILE(dib, data, 64);
+
+			Console.WriteLine("The profiles memory-address is : 0x{0}", icc.DataPointer.ToString("X"));
+			Console.WriteLine("The profiles size is : {0} bytes", icc.Size);
+
+			// CreateICCProfileEx(...) does the same as above
+			icc = FreeImage.CreateICCProfileEx(dib, data, 16);
+
+			Console.WriteLine("The profiles memory-address is : 0x{0}", icc.DataPointer.ToString("X"));
+			Console.WriteLine("The profiles size is : {0} bytes", icc.Size);
+
+			FreeImage.UnloadEx(ref dib);
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("c9991d1d-684a-4736-b088-369a216b35b6")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,94 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{3B1BB976-64A7-41FD-B7E2-59104161AF7E}</ProjectGuid>
+    <OutputType>Exe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample07</RootNamespace>
+    <AssemblyName>Sample07</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="Program.cs" />
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <None Include="Sample.jpg">
+      <CopyToOutputDirectory>Always</CopyToOutputDirectory>
+    </None>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("dc891ffc-ab5c-451f-97da-2c0d5d90edcc")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,108 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{491042DB-495B-420C-A3BE-5D13019707C5}</ProjectGuid>
+    <OutputType>WinExe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample08</RootNamespace>
+    <AssemblyName>Sample08</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Drawing" />
+    <Reference Include="System.Windows.Forms" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="Properties\AssemblyInfo.cs" />
+    <Compile Include="SampleForm.cs">
+      <SubType>Form</SubType>
+    </Compile>
+    <Compile Include="SampleForm.Designer.cs">
+      <DependentUpon>SampleForm.cs</DependentUpon>
+    </Compile>
+    <Compile Include="SerializationPlugin.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <None Include="Sample.jpg">
+      <CopyToOutputDirectory>Always</CopyToOutputDirectory>
+    </None>
+  </ItemGroup>
+  <ItemGroup>
+    <EmbeddedResource Include="SampleForm.resx">
+      <DependentUpon>SampleForm.cs</DependentUpon>
+      <SubType>Designer</SubType>
+    </EmbeddedResource>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,119 @@
+namespace Sample08
+{
+	partial class SampleForm
+	{
+		/// <summary>
+		/// Erforderliche Designervariable.
+		/// </summary>
+		private System.ComponentModel.IContainer components = null;
+
+		/// <summary>
+		/// Verwendete Ressourcen bereinigen.
+		/// </summary>
+		/// <param name="disposing">True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False.</param>
+		protected override void Dispose(bool disposing)
+		{
+			if (disposing && (components != null))
+			{
+				components.Dispose();
+			}
+			base.Dispose(disposing);
+		}
+
+		#region Vom Windows Form-Designer generierter Code
+
+		/// <summary>
+		/// Erforderliche Methode für die Designerunterstützung.
+		/// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden.
+		/// </summary>
+		private void InitializeComponent()
+		{
+			this.pictureBox = new System.Windows.Forms.PictureBox();
+			this.bLoad = new System.Windows.Forms.Button();
+			this.SaveToSer = new System.Windows.Forms.Button();
+			this.LoadSerBitmap = new System.Windows.Forms.Button();
+			this.bClearBitmap = new System.Windows.Forms.Button();
+			((System.ComponentModel.ISupportInitialize)(this.pictureBox)).BeginInit();
+			this.SuspendLayout();
+			// 
+			// pictureBox
+			// 
+			this.pictureBox.BackgroundImageLayout = System.Windows.Forms.ImageLayout.Stretch;
+			this.pictureBox.Location = new System.Drawing.Point(12, 12);
+			this.pictureBox.Name = "pictureBox";
+			this.pictureBox.Size = new System.Drawing.Size(600, 400);
+			this.pictureBox.TabIndex = 0;
+			this.pictureBox.TabStop = false;
+			// 
+			// bLoad
+			// 
+			this.bLoad.Location = new System.Drawing.Point(12, 418);
+			this.bLoad.Name = "bLoad";
+			this.bLoad.Size = new System.Drawing.Size(98, 23);
+			this.bLoad.TabIndex = 1;
+			this.bLoad.Text = "Load any bitmap";
+			this.bLoad.UseVisualStyleBackColor = true;
+			this.bLoad.Click += new System.EventHandler(this.bLoad_Click);
+			// 
+			// SaveToSer
+			// 
+			this.SaveToSer.Location = new System.Drawing.Point(324, 418);
+			this.SaveToSer.Name = "SaveToSer";
+			this.SaveToSer.Size = new System.Drawing.Size(98, 23);
+			this.SaveToSer.TabIndex = 2;
+			this.SaveToSer.Text = "Save as .ser";
+			this.SaveToSer.UseVisualStyleBackColor = true;
+			this.SaveToSer.Click += new System.EventHandler(this.SaveToSer_Click);
+			// 
+			// LoadSerBitmap
+			// 
+			this.LoadSerBitmap.Location = new System.Drawing.Point(220, 418);
+			this.LoadSerBitmap.Name = "LoadSerBitmap";
+			this.LoadSerBitmap.Size = new System.Drawing.Size(98, 23);
+			this.LoadSerBitmap.TabIndex = 3;
+			this.LoadSerBitmap.Text = "Load .ser bitmap";
+			this.LoadSerBitmap.UseVisualStyleBackColor = true;
+			this.LoadSerBitmap.Click += new System.EventHandler(this.LoadSerBitmap_Click);
+			// 
+			// bClearBitmap
+			// 
+			this.bClearBitmap.Location = new System.Drawing.Point(116, 418);
+			this.bClearBitmap.Name = "bClearBitmap";
+			this.bClearBitmap.Size = new System.Drawing.Size(98, 23);
+			this.bClearBitmap.TabIndex = 4;
+			this.bClearBitmap.Text = "Clear screen";
+			this.bClearBitmap.UseVisualStyleBackColor = true;
+			this.bClearBitmap.Click += new System.EventHandler(this.bClearBitmap_Click);
+			// 
+			// SampleForm
+			// 
+			this.AutoScaleDimensions = new System.Drawing.SizeF(6F, 13F);
+			this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
+			this.ClientSize = new System.Drawing.Size(627, 448);
+			this.Controls.Add(this.bClearBitmap);
+			this.Controls.Add(this.LoadSerBitmap);
+			this.Controls.Add(this.SaveToSer);
+			this.Controls.Add(this.bLoad);
+			this.Controls.Add(this.pictureBox);
+			this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
+			this.MaximizeBox = false;
+			this.MinimizeBox = false;
+			this.Name = "SampleForm";
+			this.ShowIcon = false;
+			this.StartPosition = System.Windows.Forms.FormStartPosition.CenterScreen;
+			this.Text = "Sample 08";
+			((System.ComponentModel.ISupportInitialize)(this.pictureBox)).EndInit();
+			this.ResumeLayout(false);
+
+		}
+
+		#endregion
+
+		private System.Windows.Forms.PictureBox pictureBox;
+		private System.Windows.Forms.Button bLoad;
+		private System.Windows.Forms.Button SaveToSer;
+		private System.Windows.Forms.Button LoadSerBitmap;
+		private System.Windows.Forms.Button bClearBitmap;
+	}
+}
+
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,217 @@
+using System;
+using System.Collections.Generic;
+using System.ComponentModel;
+using System.Drawing;
+using System.Text;
+using System.Windows.Forms;
+using FreeImageAPI;
+using System.Runtime.InteropServices;
+using System.Security.Permissions;
+
+namespace Sample08
+{
+	public partial class SampleForm : Form
+	{
+		SerializationPlugin serialPlugin;
+
+		[STAThread]
+		static void Main()
+		{
+			// Check if FreeImage is available
+			if (!FreeImage.IsAvailable())
+			{
+				throw new Exception("FreeImage is not available!");
+			}
+
+			Application.EnableVisualStyles();
+			Application.SetCompatibleTextRenderingDefault(false);
+			Application.Run(new SampleForm());
+		}
+
+		public SampleForm()
+		{
+			InitializeComponent();
+			FreeImageEngine.Message += new OutputMessageFunction(FreeImage_Message);
+
+			// Creating a new instance of the plugin will register it automatically.
+			serialPlugin = new SerializationPlugin();
+		}
+
+		void FreeImage_Message(FREE_IMAGE_FORMAT fif, string message)
+		{
+			// Show the message
+			MessageBox.Show(String.Format("Format: {0}\nMessage: {1}", fif, message), "FreeImage Message");
+		}
+
+		private void bLoad_Click(object sender, EventArgs e)
+		{
+			// Create a new dialog instance
+			OpenFileDialog ofd = new OpenFileDialog();
+			try
+			{
+				// Apply settings
+				ofd.CheckPathExists = true;
+				ofd.CheckFileExists = true;
+				ofd.RestoreDirectory = true;
+				ofd.Filter = "All files (*.*)|*.*";
+				
+				// Get filename
+				if (ofd.ShowDialog(this) == DialogResult.OK)
+				{
+					Bitmap bitmap = null;
+					try
+					{
+						// Try loading the selected file
+						// a ser-file will create an exception
+						bitmap = (Bitmap)Bitmap.FromFile(ofd.FileName);
+					}
+					catch
+					{
+						MessageBox.Show("Unable to load bitmap from file.", "Error");
+						return;
+					}
+
+					// Unload old bitmap
+					if (pictureBox.Image != null)
+					{
+						pictureBox.Image.Dispose();
+					}
+
+					// Set new bitmap
+					pictureBox.Image = bitmap;
+					MessageBox.Show("Bitmap loaded successfully", "Success");
+				}
+				else
+				{
+					MessageBox.Show("Action aborted.");
+				}
+			}
+			finally
+			{
+				// Unload dialog
+				ofd.Dispose();
+			}
+		}
+
+		private void LoadSerBitmap_Click(object sender, EventArgs e)
+		{
+			// Creat a new dialog
+			OpenFileDialog ofd = new OpenFileDialog();
+
+			FIBITMAP dib = new FIBITMAP();
+			try
+			{
+				// Apply settings
+				ofd.CheckPathExists = true;
+				ofd.CheckFileExists = true;
+				ofd.RestoreDirectory = true;
+				ofd.Filter = "Serialized bitmap (*.ser)|*.ser";
+				
+				// Get filename
+				if (ofd.ShowDialog() == DialogResult.OK)
+				{
+					// Try loading the file forcing the new format
+					dib = FreeImage.Load(serialPlugin.Format, ofd.FileName, FREE_IMAGE_LOAD_FLAGS.DEFAULT);
+					if (dib.IsNull)
+					{
+						MessageBox.Show("Loading bitmap failed", "Error");
+						return;
+					}
+
+					// Convert the loaded bitmap into a .NET bitmap
+					Bitmap bitmap = FreeImage.GetBitmap(dib);
+					if (bitmap == null)
+					{
+						MessageBox.Show("Converting bitmap failed.", "Error");
+						return;
+					}
+
+					// Unload the picturebox
+					if (pictureBox.Image != null)
+					{
+						pictureBox.Image.Dispose();
+					}
+
+					// Apply the loaded bitmap
+					pictureBox.Image = bitmap;
+					MessageBox.Show("Bitmap loaded successfully", "Success");
+				}
+				else
+				{
+					MessageBox.Show("Action aborted.");
+				}
+			}
+			finally
+			{
+				// Unload bitmap
+				FreeImage.UnloadEx(ref dib);
+
+				// Unload dialog
+				ofd.Dispose();
+			}
+		}
+
+		private void SaveToSer_Click(object sender, EventArgs e)
+		{
+			// Create a new dialog
+			SaveFileDialog sfd = new SaveFileDialog();
+
+			FIBITMAP dib = new FIBITMAP();
+			try
+			{
+				// Check if the picture box contains a bitmap that can be saved.
+				if (pictureBox.Image == null)
+				{
+					MessageBox.Show("No bitmap loaded.", "Error");
+					return;
+				}
+
+				// Convert the picture-boxes bitmap into a FreeImage bitmap.
+				dib = FreeImage.CreateFromBitmap((Bitmap)pictureBox.Image);
+				if (dib.IsNull)
+				{
+					MessageBox.Show("Unable to convert bitmap to FIBITMAP.", "Error");
+					return;
+				}
+
+				// Apply settings
+				sfd.Filter = "Serialized bitmap (*.ser)|*.ser";
+				sfd.FileName = "Bitmap.ser";
+				sfd.OverwritePrompt = true;
+				sfd.RestoreDirectory = true;
+				
+				// Get filename
+				if (sfd.ShowDialog() == DialogResult.OK)
+				{
+					// Save bitmap in the new format
+					if (FreeImage.SaveEx(dib, sfd.FileName, serialPlugin.Format))
+						MessageBox.Show("Bitmap saved successfully.", "Success");
+					else
+						MessageBox.Show("Saving bitmap failed.", "Failure");
+				}
+				else
+				{
+					MessageBox.Show("Action aborted.");
+				}
+			}
+			finally
+			{
+				// Unload bitmap
+				FreeImage.UnloadEx(ref dib);
+
+				// Unload dialog
+				sfd.Dispose();
+			}
+		}
+
+		private void bClearBitmap_Click(object sender, EventArgs e)
+		{
+			// Unload the picture-box
+			if (pictureBox.Image != null)
+			{
+				pictureBox.Image.Dispose();
+				pictureBox.Image = null;
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,120 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <!-- 
+    Microsoft ResX Schema 
+    
+    Version 2.0
+    
+    The primary goals of this format is to allow a simple XML format 
+    that is mostly human readable. The generation and parsing of the 
+    various data types are done through the TypeConverter classes 
+    associated with the data types.
+    
+    Example:
+    
+    ... ado.net/XML headers & schema ...
+    <resheader name="resmimetype">text/microsoft-resx</resheader>
+    <resheader name="version">2.0</resheader>
+    <resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
+    <resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
+    <data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
+    <data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
+    <data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
+        <value>[base64 mime encoded serialized .NET Framework object]</value>
+    </data>
+    <data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
+        <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
+        <comment>This is a comment</comment>
+    </data>
+                
+    There are any number of "resheader" rows that contain simple 
+    name/value pairs.
+    
+    Each data row contains a name, and value. The row also contains a 
+    type or mimetype. Type corresponds to a .NET class that support 
+    text/value conversion through the TypeConverter architecture. 
+    Classes that don't support this are serialized and stored with the 
+    mimetype set.
+    
+    The mimetype is used for serialized objects, and tells the 
+    ResXResourceReader how to depersist the object. This is currently not 
+    extensible. For a given mimetype the value must be set accordingly:
+    
+    Note - application/x-microsoft.net.object.binary.base64 is the format 
+    that the ResXResourceWriter will generate, however the reader can 
+    read any of the formats listed below.
+    
+    mimetype: application/x-microsoft.net.object.binary.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
+            : and then encoded with base64 encoding.
+    
+    mimetype: application/x-microsoft.net.object.soap.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
+            : and then encoded with base64 encoding.
+
+    mimetype: application/x-microsoft.net.object.bytearray.base64
+    value   : The object must be serialized into a byte array 
+            : using a System.ComponentModel.TypeConverter
+            : and then encoded with base64 encoding.
+    -->
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
+              <xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
+              <xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+</root>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,222 @@
+using System;
+using System.Collections.Generic;
+using System.Text;
+using System.Runtime.InteropServices;
+using System.Runtime.Serialization.Formatters.Binary;
+using System.IO;
+using System.IO.Compression;
+using FreeImageAPI;
+using FreeImageAPI.IO;
+using FreeImageAPI.Plugins;
+
+namespace Sample08
+{
+	public sealed class SerializationPlugin : LocalPlugin
+	{
+		// Header for the file
+		private byte[] header = new byte[] { 0xff, 0x12, 0x0f, 0xff, 0x01, 0x00 };
+
+		// Structure that will store all bitmap data.
+		[Serializable]
+		private struct SerialDib
+		{
+			public uint width;
+			public uint height;
+			public int pitch;
+			public uint bpp;
+			public uint red_mask;
+			public uint green_mask;
+			public uint blue_mask;
+			public byte[] data;
+		}
+
+		// Implementation of 'GetImplementedMethods()'
+		// All implemented methods are listed.
+		protected override LocalPlugin.MethodFlags GetImplementedMethods()
+		{
+			return
+				MethodFlags.DescriptionProc |
+				MethodFlags.SupportsExportBPPProc |
+				MethodFlags.SupportsExportTypeProc |
+				MethodFlags.SupportsICCProfilesProc |
+				MethodFlags.LoadProc |
+				MethodFlags.SaveProc |
+				MethodFlags.ValidateProc |
+				MethodFlags.ExtensionListProc;
+		}
+
+		// Returns a format string.
+		protected override string FormatProc()
+		{
+			return "Serialization";
+		}
+
+		// Returns a more specific description
+		protected override string DescriptionProc()
+		{
+			return "Serializes bitmaps for .NET";
+		}
+
+		// Returns whether a color depth is supported.
+		protected override bool SupportsExportBPPProc(int bpp)
+		{
+			return ((bpp == 1) ||
+					(bpp == 4) ||
+					(bpp == 8) ||
+					(bpp == 16) ||
+					(bpp == 24) ||
+					(bpp == 32));
+		}
+
+		// This plugin can only export standard bitmaps
+		protected override bool SupportsExportTypeProc(FREE_IMAGE_TYPE type)
+		{
+			return (type == FREE_IMAGE_TYPE.FIT_BITMAP);
+		}
+
+		// This plugin does not support icc profiles
+		protected override bool SupportsICCProfilesProc()
+		{
+			return false;
+		}
+
+		// The function reads the first bytes of the file and compares it
+		// with the predefined header.
+		protected override bool ValidateProc(ref FreeImageIO io, fi_handle handle)
+		{
+			for (int i = 0; i < header.Length; i++)
+				if (ReadByte(io, handle) != header[i])
+					return false;
+			return true;
+		}
+
+		// Loading function
+		protected override FIBITMAP LoadProc(ref FreeImageIO io, fi_handle handle, int page, int flags, IntPtr data)
+		{
+			// Check if the data has the correct format
+			if (!ValidateProc(ref io, handle))
+			{
+				// Create a free-image message
+				FreeImage.OutputMessageProc(format, "Invalid format.");
+				// return 0 (operation failed)
+				return FIBITMAP.Zero;
+			}
+
+			SerialDib sdib;
+			int read = 0;
+			System.IO.MemoryStream stream = new System.IO.MemoryStream();
+			byte[] buffer = new byte[1024];
+
+			do
+			{
+				// Use the helper function 'Read' to read from the source
+				read = Read(io, handle, 1, 1024, ref buffer);
+
+				// Store the data in a temporary buffer
+				stream.Write(buffer, 0, read);
+			}
+			while (read != 0);
+
+			// Set the memory stream back to the beginning.
+			stream.Position = 0;
+
+			// Unzip the stream
+			GZipStream zipStream = new GZipStream(stream, CompressionMode.Decompress);
+
+			// Create a serializer
+			BinaryFormatter formatter = new BinaryFormatter();
+
+			// Deserialize the stream
+			sdib = (SerialDib)formatter.Deserialize(zipStream);
+
+			// Unload the stream
+			zipStream.Dispose();
+
+			// Use 'ConvertFromRawBits and the deserialized struct to recreate the bitmap
+			// In this case the marshaller is used to create the needed IntPtr to the data
+			// array.
+			FIBITMAP dib = FreeImage.ConvertFromRawBits(
+				Marshal.UnsafeAddrOfPinnedArrayElement(sdib.data, 0),
+				(int)sdib.width, (int)sdib.height, sdib.pitch, sdib.bpp,
+				sdib.red_mask, sdib.green_mask, sdib.blue_mask,
+				false);
+
+			// Unload the temporary stream
+			stream.Dispose();
+
+			// Return the created bitmap
+			return dib;
+		}
+
+		// Saving function
+		protected override bool SaveProc(ref FreeImageIO io, FIBITMAP dib, fi_handle handle, int page, int flags, IntPtr data)
+		{
+			SerialDib sdib;
+			uint size = FreeImage.GetDIBSize(dib);
+
+			// Store all data needed to recreate the bitmap
+			sdib.width = FreeImage.GetWidth(dib);
+			sdib.height = FreeImage.GetHeight(dib);
+			sdib.pitch = (int)FreeImage.GetPitch(dib);
+			sdib.bpp = FreeImage.GetBPP(dib);
+			sdib.red_mask = FreeImage.GetRedMask(dib);
+			sdib.green_mask = FreeImage.GetGreenMask(dib);
+			sdib.blue_mask = FreeImage.GetBlueMask(dib);
+			sdib.data = new byte[size];
+
+			// Copy the bitmaps data into the structures byte-array
+			// The marshaller is used to create an IntPtr for using
+			// 'ConvertToRawBits'.
+			FreeImage.ConvertToRawBits(Marshal.UnsafeAddrOfPinnedArrayElement(sdib.data, 0),
+						  dib, sdib.pitch, sdib.bpp,
+						  sdib.red_mask, sdib.green_mask, sdib.blue_mask,
+						  false);
+
+			// Use the healper function to write the header to the destination
+			if (Write(io, handle, (uint)header.Length, 1, ref header) != 1)
+				return false;
+
+			// Create a serializer
+			BinaryFormatter formatter = new BinaryFormatter();
+
+			// Create a temporary stream
+			MemoryStream stream = new MemoryStream();
+
+			// Create a compression stream
+			GZipStream zipStream = new GZipStream(stream, CompressionMode.Compress);
+
+			// Serialize the structure into the compression stream
+			formatter.Serialize(zipStream, sdib);
+
+			// Unload the compression stream
+			zipStream.Dispose();
+
+			// Get the result data
+			byte[] buffer = stream.GetBuffer();
+
+			// Use the healper function 'Write' to write the data to the destination
+			if (Write(io, handle, 1, (uint)buffer.Length, ref buffer) != buffer.Length)
+			{
+				// Unload the temporary stream
+				stream.Dispose();
+				return false;
+			}
+
+			// Unload the temporary stream
+			stream.Dispose();
+			return true;
+		}
+
+		// Return a list of supported file extensions (comma seperated)
+		protected override string ExtensionListProc()
+		{
+			return "ser";
+		}
+
+		// Implementation of 'ToString()'
+		public override string ToString()
+		{
+			return DescriptionProc();
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("7f29fbaa-d2b3-4011-b34f-5a109bc282af")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,103 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{92A454B2-67EF-4B70-99C9-F22B83B6FBFF}</ProjectGuid>
+    <OutputType>WinExe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample09</RootNamespace>
+    <AssemblyName>Sample09</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Data" />
+    <Reference Include="System.Drawing" />
+    <Reference Include="System.Windows.Forms" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="Properties\AssemblyInfo.cs" />
+    <Compile Include="SampleForm.cs">
+      <SubType>Form</SubType>
+    </Compile>
+    <Compile Include="SampleForm.Designer.cs">
+      <DependentUpon>SampleForm.cs</DependentUpon>
+    </Compile>
+  </ItemGroup>
+  <ItemGroup>
+    <EmbeddedResource Include="SampleForm.resx">
+      <SubType>Designer</SubType>
+      <DependentUpon>SampleForm.cs</DependentUpon>
+    </EmbeddedResource>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,115 @@
+namespace Sample09
+{
+	partial class SampleForm
+	{
+		/// <summary>
+		/// Erforderliche Designervariable.
+		/// </summary>
+		private System.ComponentModel.IContainer components = null;
+
+		/// <summary>
+		/// Verwendete Ressourcen bereinigen.
+		/// </summary>
+		/// <param name="disposing">True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False.</param>
+		protected override void Dispose(bool disposing)
+		{
+			if (disposing && (components != null))
+			{
+				components.Dispose();
+			}
+			base.Dispose(disposing);
+		}
+
+		#region Vom Windows Form-Designer generierter Code
+
+		/// <summary>
+		/// Erforderliche Methode für die Designerunterstützung.
+		/// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden.
+		/// </summary>
+		private void InitializeComponent()
+		{
+			this.picBox = new System.Windows.Forms.PictureBox();
+			this.tbURL = new System.Windows.Forms.TextBox();
+			this.lUrl = new System.Windows.Forms.Label();
+			this.bLoadUrl = new System.Windows.Forms.Button();
+			this.bSave = new System.Windows.Forms.Button();
+			((System.ComponentModel.ISupportInitialize)(this.picBox)).BeginInit();
+			this.SuspendLayout();
+			// 
+			// picBox
+			// 
+			this.picBox.BorderStyle = System.Windows.Forms.BorderStyle.FixedSingle;
+			this.picBox.Location = new System.Drawing.Point(12, 12);
+			this.picBox.Name = "picBox";
+			this.picBox.Size = new System.Drawing.Size(536, 299);
+			this.picBox.TabIndex = 0;
+			this.picBox.TabStop = false;
+			// 
+			// tbURL
+			// 
+			this.tbURL.Location = new System.Drawing.Point(155, 317);
+			this.tbURL.Name = "tbURL";
+			this.tbURL.Size = new System.Drawing.Size(393, 20);
+			this.tbURL.TabIndex = 1;
+			this.tbURL.Text = "http://freeimage.sourceforge.net/images/logo.jpg";
+			// 
+			// lUrl
+			// 
+			this.lUrl.AutoSize = true;
+			this.lUrl.Location = new System.Drawing.Point(9, 320);
+			this.lUrl.Name = "lUrl";
+			this.lUrl.Size = new System.Drawing.Size(137, 13);
+			this.lUrl.TabIndex = 2;
+			this.lUrl.Text = "Enter the URL of an Image:";
+			// 
+			// bLoadUrl
+			// 
+			this.bLoadUrl.Location = new System.Drawing.Point(12, 344);
+			this.bLoadUrl.Name = "bLoadUrl";
+			this.bLoadUrl.Size = new System.Drawing.Size(75, 23);
+			this.bLoadUrl.TabIndex = 3;
+			this.bLoadUrl.Text = "Load URL";
+			this.bLoadUrl.UseVisualStyleBackColor = true;
+			this.bLoadUrl.Click += new System.EventHandler(this.bLoadUrl_Click);
+			// 
+			// bSave
+			// 
+			this.bSave.Location = new System.Drawing.Point(93, 344);
+			this.bSave.Name = "bSave";
+			this.bSave.Size = new System.Drawing.Size(75, 23);
+			this.bSave.TabIndex = 4;
+			this.bSave.Text = "Save to disk";
+			this.bSave.UseVisualStyleBackColor = true;
+			this.bSave.Click += new System.EventHandler(this.bSave_Click);
+			// 
+			// SampleForm
+			// 
+			this.AutoScaleDimensions = new System.Drawing.SizeF(6F, 13F);
+			this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
+			this.ClientSize = new System.Drawing.Size(560, 379);
+			this.Controls.Add(this.bSave);
+			this.Controls.Add(this.bLoadUrl);
+			this.Controls.Add(this.lUrl);
+			this.Controls.Add(this.tbURL);
+			this.Controls.Add(this.picBox);
+			this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
+			this.MaximizeBox = false;
+			this.MinimizeBox = false;
+			this.Name = "SampleForm";
+			this.StartPosition = System.Windows.Forms.FormStartPosition.CenterScreen;
+			this.Text = "Sample09";
+			((System.ComponentModel.ISupportInitialize)(this.picBox)).EndInit();
+			this.ResumeLayout(false);
+			this.PerformLayout();
+
+		}
+
+		#endregion
+
+		private System.Windows.Forms.PictureBox picBox;
+		private System.Windows.Forms.TextBox tbURL;
+		private System.Windows.Forms.Label lUrl;
+		private System.Windows.Forms.Button bLoadUrl;
+		private System.Windows.Forms.Button bSave;
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,147 @@
+using System;
+using System.Collections.Generic;
+using System.ComponentModel;
+using System.Data;
+using System.Drawing;
+using System.Text;
+using System.Windows.Forms;
+using FreeImageAPI;
+using System.Net;
+using System.IO;
+
+namespace Sample09
+{
+	public partial class SampleForm : Form
+	{
+		[STAThread]
+		static void Main()
+		{
+			// Check if FreeImage is available
+			if (!FreeImage.IsAvailable())
+			{
+				throw new Exception("FreeImage is not available!");
+			}
+
+			Application.EnableVisualStyles();
+			Application.SetCompatibleTextRenderingDefault(false);
+			Application.Run(new SampleForm());
+		}
+
+		public SampleForm()
+		{
+			InitializeComponent();
+		}
+
+		private void bLoadUrl_Click(object sender, EventArgs e)
+		{
+			// Verify url
+			if (String.IsNullOrEmpty(tbURL.Text))
+			{
+				MessageBox.Show("Please enter a valid URL.", "Error");
+				return;
+			}
+			FIBITMAP dib = new FIBITMAP();
+			Stream sourceStream = null;
+			try
+			{
+				// Build a stream to read from
+				WebRequest request = (WebRequest)HttpWebRequest.Create(tbURL.Text);
+				WebResponse response = request.GetResponse();
+				sourceStream = response.GetResponseStream();
+				if (sourceStream == null)
+				{
+					throw new Exception();
+				}
+				// Load the image from stream
+				dib = FreeImage.LoadFromStream(sourceStream);
+				// Check success
+				if (dib.IsNull)
+				{
+					throw new Exception();
+				}
+				// Convert the bitmap into a .NET bitmap
+				Bitmap bitmap = FreeImage.GetBitmap(dib);
+				if (bitmap == null)
+				{
+					throw new Exception();
+				}
+				// Show the bitmap
+				if (picBox.Image != null)
+				{
+					picBox.Image.Dispose();
+				}
+				picBox.Image = bitmap;
+			}
+			catch
+			{
+				// Error handling
+				MessageBox.Show("Error loading URL.", "Error");
+			}
+			finally
+			{
+				// Clean up memory
+				FreeImage.UnloadEx(ref dib);
+				if (sourceStream != null) sourceStream.Dispose();
+			}
+		}
+
+		private void bSave_Click(object sender, EventArgs e)
+		{
+			// Check if there is a loaded bitmap
+			if (picBox.Image == null)
+			{
+				MessageBox.Show("No image loaded.", "Error");
+				return;
+			}
+			SaveFileDialog sfd = null;
+			FileStream fStream = null;
+			FIBITMAP dib = new FIBITMAP();
+			try
+			{
+				sfd = new SaveFileDialog();
+				sfd.CreatePrompt = false;
+				sfd.FileName = "";
+				sfd.Filter = "TIF (*tif)|*.tif";
+				sfd.OverwritePrompt = true;
+				sfd.RestoreDirectory = true;
+				if (sfd.ShowDialog() == DialogResult.OK)
+				{
+					// Convert the .NET bitmap into a FreeImage-Bitmap
+					dib = FreeImage.CreateFromBitmap((Bitmap)picBox.Image);
+					if (dib.IsNull)
+					{
+						throw new Exception();
+					}
+					// Create a filestream to write to
+					fStream = new FileStream(sfd.FileName, FileMode.Create);
+					if (!FreeImage.SaveToStream(
+						ref dib,
+						fStream,
+						FREE_IMAGE_FORMAT.FIF_TIFF,
+						FREE_IMAGE_SAVE_FLAGS.TIFF_LZW,
+						FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
+						false))
+					{
+						throw new Exception();
+					}
+					MessageBox.Show("Image saved successfully.", "Success");
+				}
+				else
+				{
+					MessageBox.Show("Operation aborted.", "Aborted");
+				}
+			}
+			catch
+			{
+				MessageBox.Show("Error saving image.", "Error");
+			}
+			finally
+			{
+				// Clean up
+				if (sfd != null) sfd.Dispose();
+				if (fStream != null) fStream.Dispose();
+				FreeImage.UnloadEx(ref dib);
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,120 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <!-- 
+    Microsoft ResX Schema 
+    
+    Version 2.0
+    
+    The primary goals of this format is to allow a simple XML format 
+    that is mostly human readable. The generation and parsing of the 
+    various data types are done through the TypeConverter classes 
+    associated with the data types.
+    
+    Example:
+    
+    ... ado.net/XML headers & schema ...
+    <resheader name="resmimetype">text/microsoft-resx</resheader>
+    <resheader name="version">2.0</resheader>
+    <resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
+    <resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
+    <data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
+    <data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
+    <data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
+        <value>[base64 mime encoded serialized .NET Framework object]</value>
+    </data>
+    <data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
+        <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
+        <comment>This is a comment</comment>
+    </data>
+                
+    There are any number of "resheader" rows that contain simple 
+    name/value pairs.
+    
+    Each data row contains a name, and value. The row also contains a 
+    type or mimetype. Type corresponds to a .NET class that support 
+    text/value conversion through the TypeConverter architecture. 
+    Classes that don't support this are serialized and stored with the 
+    mimetype set.
+    
+    The mimetype is used for serialized objects, and tells the 
+    ResXResourceReader how to depersist the object. This is currently not 
+    extensible. For a given mimetype the value must be set accordingly:
+    
+    Note - application/x-microsoft.net.object.binary.base64 is the format 
+    that the ResXResourceWriter will generate, however the reader can 
+    read any of the formats listed below.
+    
+    mimetype: application/x-microsoft.net.object.binary.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
+            : and then encoded with base64 encoding.
+    
+    mimetype: application/x-microsoft.net.object.soap.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
+            : and then encoded with base64 encoding.
+
+    mimetype: application/x-microsoft.net.object.bytearray.base64
+    value   : The object must be serialized into a byte array 
+            : using a System.ComponentModel.TypeConverter
+            : and then encoded with base64 encoding.
+    -->
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
+              <xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
+              <xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+</root>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,87 @@
+namespace Sample10
+{
+	partial class MainForm
+	{
+		/// <summary>
+		/// Erforderliche Designervariable.
+		/// </summary>
+		private System.ComponentModel.IContainer components = null;
+
+		/// <summary>
+		/// Verwendete Ressourcen bereinigen.
+		/// </summary>
+		/// <param name="disposing">True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False.</param>
+		protected override void Dispose(bool disposing)
+		{
+			if (disposing && (components != null))
+			{
+				components.Dispose();
+			}
+			base.Dispose(disposing);
+		}
+
+		#region Vom Windows Form-Designer generierter Code
+
+		/// <summary>
+		/// Erforderliche Methode für die Designerunterstützung.
+		/// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden.
+		/// </summary>
+		private void InitializeComponent()
+		{
+			this.bLoad = new System.Windows.Forms.Button();
+			this.bQuit = new System.Windows.Forms.Button();
+			this.tvMetadata = new System.Windows.Forms.TreeView();
+			this.SuspendLayout();
+			// 
+			// bLoad
+			// 
+			this.bLoad.Location = new System.Drawing.Point(12, 336);
+			this.bLoad.Name = "bLoad";
+			this.bLoad.Size = new System.Drawing.Size(75, 23);
+			this.bLoad.TabIndex = 0;
+			this.bLoad.Text = "Load Image";
+			this.bLoad.UseVisualStyleBackColor = true;
+			this.bLoad.Click += new System.EventHandler(this.bLoad_Click);
+			// 
+			// bQuit
+			// 
+			this.bQuit.Location = new System.Drawing.Point(328, 336);
+			this.bQuit.Name = "bQuit";
+			this.bQuit.Size = new System.Drawing.Size(75, 23);
+			this.bQuit.TabIndex = 1;
+			this.bQuit.Text = "Quit";
+			this.bQuit.UseVisualStyleBackColor = true;
+			this.bQuit.Click += new System.EventHandler(this.bQuit_Click);
+			// 
+			// tvMetadata
+			// 
+			this.tvMetadata.Location = new System.Drawing.Point(12, 12);
+			this.tvMetadata.Name = "tvMetadata";
+			this.tvMetadata.Size = new System.Drawing.Size(389, 318);
+			this.tvMetadata.TabIndex = 2;
+			// 
+			// MainForm
+			// 
+			this.AutoScaleDimensions = new System.Drawing.SizeF(6F, 13F);
+			this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
+			this.ClientSize = new System.Drawing.Size(415, 371);
+			this.Controls.Add(this.tvMetadata);
+			this.Controls.Add(this.bQuit);
+			this.Controls.Add(this.bLoad);
+			this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
+			this.MaximizeBox = false;
+			this.MinimizeBox = false;
+			this.Name = "MainForm";
+			this.StartPosition = System.Windows.Forms.FormStartPosition.CenterScreen;
+			this.Text = "MainForm";
+			this.ResumeLayout(false);
+
+		}
+
+		#endregion
+
+		private System.Windows.Forms.Button bLoad;
+		private System.Windows.Forms.Button bQuit;
+		private System.Windows.Forms.TreeView tvMetadata;
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,105 @@
+using System;
+using System.Collections.Generic;
+using System.Drawing;
+using System.Windows.Forms;
+using FreeImageAPI;
+using FreeImageAPI.Metadata;
+
+namespace Sample10
+{
+	public partial class MainForm : Form
+	{
+		[STAThread]
+		static void Main()
+		{
+			// Check if FreeImage.dll is available
+			if (!FreeImage.IsAvailable())
+			{
+				MessageBox.Show("FreeImage is not available. Aborting.", "Error");
+			}
+
+			// Add this class to the FreeImage-Message-Callback
+			FreeImageEngine.Message += new OutputMessageFunction(FreeImage_Message);
+
+			Application.EnableVisualStyles();
+			Application.SetCompatibleTextRenderingDefault(false);
+			Application.Run(new MainForm());
+		}
+
+		static void FreeImage_Message(FREE_IMAGE_FORMAT fif, string message)
+		{
+			// Display the data
+			MessageBox.Show(
+				String.Format("FreeImage-Message:\n{1}\nFormat:{0}", fif.ToString(), message),
+				"FreeImage-Message");
+		}
+
+		public MainForm()
+		{
+			InitializeComponent();
+		}
+
+		private void bQuit_Click(object sender, EventArgs e)
+		{
+			Application.Exit();
+		}
+
+		private void bLoad_Click(object sender, EventArgs e)
+		{
+			// Create variables
+			OpenFileDialog ofd = new OpenFileDialog();
+			FIBITMAP dib = new FIBITMAP();
+			try
+			{
+				// Apply settings
+				ofd.CheckFileExists = true;
+				ofd.CheckPathExists = true;
+				ofd.FileName = "";
+				ofd.Filter = "All files (*.*)|*.*";
+				ofd.Multiselect = false;
+				ofd.RestoreDirectory = true;
+				// Get image filename
+				if (ofd.ShowDialog() == DialogResult.OK)
+				{
+					// Load the image
+					dib = FreeImage.LoadEx(ofd.FileName);
+					// Check if image was loaded successfully
+					if (dib.IsNull) throw new Exception("Failed to load image.");
+					// Clear the treeview
+					tvMetadata.Nodes.Clear();
+					// Create a wrapper for all metadata the image contains
+					ImageMetadata iMetadata = new ImageMetadata(dib);
+					// Get each metadata model
+					foreach (MetadataModel metadataModel in iMetadata)
+					{
+						// Create a new node for each model
+						TreeNode modelNode = tvMetadata.Nodes.Add(metadataModel.ToString());
+						
+						// Get each metadata tag and create a subnode for it
+						foreach (MetadataTag metadataTag in metadataModel)
+						{
+							modelNode.Nodes.Add(metadataTag.Key + ": " + metadataTag.ToString());
+						}
+					}
+				}
+				else
+				{
+					MessageBox.Show("Operation aborted.", "Aborted");
+				}				
+			}
+			// Display error message
+			catch (Exception ex)
+			{
+				while (ex.InnerException != null)
+					ex = ex.InnerException;
+				MessageBox.Show(ex.ToString(), "Exception caught");
+			}
+			// Clean up
+			finally
+			{
+				ofd.Dispose();
+				FreeImage.UnloadEx(ref dib);
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,120 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <!-- 
+    Microsoft ResX Schema 
+    
+    Version 2.0
+    
+    The primary goals of this format is to allow a simple XML format 
+    that is mostly human readable. The generation and parsing of the 
+    various data types are done through the TypeConverter classes 
+    associated with the data types.
+    
+    Example:
+    
+    ... ado.net/XML headers & schema ...
+    <resheader name="resmimetype">text/microsoft-resx</resheader>
+    <resheader name="version">2.0</resheader>
+    <resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
+    <resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
+    <data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
+    <data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
+    <data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
+        <value>[base64 mime encoded serialized .NET Framework object]</value>
+    </data>
+    <data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
+        <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
+        <comment>This is a comment</comment>
+    </data>
+                
+    There are any number of "resheader" rows that contain simple 
+    name/value pairs.
+    
+    Each data row contains a name, and value. The row also contains a 
+    type or mimetype. Type corresponds to a .NET class that support 
+    text/value conversion through the TypeConverter architecture. 
+    Classes that don't support this are serialized and stored with the 
+    mimetype set.
+    
+    The mimetype is used for serialized objects, and tells the 
+    ResXResourceReader how to depersist the object. This is currently not 
+    extensible. For a given mimetype the value must be set accordingly:
+    
+    Note - application/x-microsoft.net.object.binary.base64 is the format 
+    that the ResXResourceWriter will generate, however the reader can 
+    read any of the formats listed below.
+    
+    mimetype: application/x-microsoft.net.object.binary.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
+            : and then encoded with base64 encoding.
+    
+    mimetype: application/x-microsoft.net.object.soap.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
+            : and then encoded with base64 encoding.
+
+    mimetype: application/x-microsoft.net.object.bytearray.base64
+    value   : The object must be serialized into a byte array 
+            : using a System.ComponentModel.TypeConverter
+            : and then encoded with base64 encoding.
+    -->
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
+              <xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
+              <xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+</root>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("e8da4fa8-cc15-4b0e-8c57-d55ceb771559")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,101 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{55DCC37A-E56C-44D9-9C44-8DAB10CD3003}</ProjectGuid>
+    <OutputType>WinExe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample10</RootNamespace>
+    <AssemblyName>Sample10</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>prompt</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <ErrorReport>prompt</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Data" />
+    <Reference Include="System.Drawing" />
+    <Reference Include="System.Windows.Forms" />
+    <Reference Include="System.Xml" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="MainForm.cs">
+      <SubType>Form</SubType>
+    </Compile>
+    <Compile Include="MainForm.Designer.cs">
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </Compile>
+    <Compile Include="Properties\AssemblyInfo.cs" />
+  </ItemGroup>
+  <ItemGroup>
+    <EmbeddedResource Include="MainForm.resx">
+      <SubType>Designer</SubType>
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </EmbeddedResource>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,382 @@
+namespace Sample11
+{
+	partial class MainForm
+	{
+		/// <summary>
+		/// Erforderliche Designervariable.
+		/// </summary>
+		private System.ComponentModel.IContainer components = null;
+
+		/// <summary>
+		/// Verwendete Ressourcen bereinigen.
+		/// </summary>
+		/// <param name="disposing">True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False.</param>
+		protected override void Dispose(bool disposing)
+		{
+			if (disposing && (components != null))
+			{
+				components.Dispose();
+			}
+			base.Dispose(disposing);
+		}
+
+		#region Vom Windows Form-Designer generierter Code
+
+		/// <summary>
+		/// Erforderliche Methode für die Designerunterstützung.
+		/// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden.
+		/// </summary>
+		private void InitializeComponent()
+		{
+			this.pictureBox = new System.Windows.Forms.PictureBox();
+			this.bLoadImage = new System.Windows.Forms.Button();
+			this.bSaveImage = new System.Windows.Forms.Button();
+			this.ofd = new System.Windows.Forms.OpenFileDialog();
+			this.sfd = new System.Windows.Forms.SaveFileDialog();
+			this.lWidth = new System.Windows.Forms.Label();
+			this.lHeight = new System.Windows.Forms.Label();
+			this.lBpp = new System.Windows.Forms.Label();
+			this.lMetadataCount = new System.Windows.Forms.Label();
+			this.bGreyscale = new System.Windows.Forms.Button();
+			this.cbSelectFrame = new System.Windows.Forms.ComboBox();
+			this.lComment = new System.Windows.Forms.Label();
+			this.bAdjustGamma = new System.Windows.Forms.Button();
+			this.vGamma = new System.Windows.Forms.NumericUpDown();
+			this.bRedChannelOnly = new System.Windows.Forms.Button();
+			this.bBlueChannel = new System.Windows.Forms.Button();
+			this.bGreenChannel = new System.Windows.Forms.Button();
+			this.bAllChannels = new System.Windows.Forms.Button();
+			this.lSelectFrame = new System.Windows.Forms.Label();
+			this.lImageFormat = new System.Windows.Forms.Label();
+			this.bRotate = new System.Windows.Forms.Button();
+			this.vRotate = new System.Windows.Forms.TrackBar();
+			this.lRotate = new System.Windows.Forms.Label();
+			this.lColors = new System.Windows.Forms.Label();
+			this.nShowMetadata = new System.Windows.Forms.Button();
+			((System.ComponentModel.ISupportInitialize)(this.pictureBox)).BeginInit();
+			((System.ComponentModel.ISupportInitialize)(this.vGamma)).BeginInit();
+			((System.ComponentModel.ISupportInitialize)(this.vRotate)).BeginInit();
+			this.SuspendLayout();
+			// 
+			// pictureBox
+			// 
+			this.pictureBox.BorderStyle = System.Windows.Forms.BorderStyle.FixedSingle;
+			this.pictureBox.Location = new System.Drawing.Point(14, 15);
+			this.pictureBox.Margin = new System.Windows.Forms.Padding(4);
+			this.pictureBox.Name = "pictureBox";
+			this.pictureBox.Size = new System.Drawing.Size(542, 395);
+			this.pictureBox.SizeMode = System.Windows.Forms.PictureBoxSizeMode.StretchImage;
+			this.pictureBox.TabIndex = 0;
+			this.pictureBox.TabStop = false;
+			// 
+			// bLoadImage
+			// 
+			this.bLoadImage.Location = new System.Drawing.Point(564, 15);
+			this.bLoadImage.Margin = new System.Windows.Forms.Padding(4);
+			this.bLoadImage.Name = "bLoadImage";
+			this.bLoadImage.Size = new System.Drawing.Size(125, 28);
+			this.bLoadImage.TabIndex = 1;
+			this.bLoadImage.Text = "Load image";
+			this.bLoadImage.UseVisualStyleBackColor = true;
+			this.bLoadImage.Click += new System.EventHandler(this.bLoadImage_Click);
+			// 
+			// bSaveImage
+			// 
+			this.bSaveImage.Location = new System.Drawing.Point(564, 51);
+			this.bSaveImage.Margin = new System.Windows.Forms.Padding(4);
+			this.bSaveImage.Name = "bSaveImage";
+			this.bSaveImage.Size = new System.Drawing.Size(125, 28);
+			this.bSaveImage.TabIndex = 2;
+			this.bSaveImage.Text = "Save image";
+			this.bSaveImage.UseVisualStyleBackColor = true;
+			this.bSaveImage.Click += new System.EventHandler(this.bSaveImage_Click);
+			// 
+			// ofd
+			// 
+			this.ofd.AddExtension = false;
+			this.ofd.AutoUpgradeEnabled = false;
+			this.ofd.Filter = "All files|*.*";
+			this.ofd.RestoreDirectory = true;
+			this.ofd.SupportMultiDottedExtensions = true;
+			// 
+			// sfd
+			// 
+			this.sfd.AddExtension = false;
+			this.sfd.Filter = "All files|*.*";
+			this.sfd.RestoreDirectory = true;
+			this.sfd.SupportMultiDottedExtensions = true;
+			// 
+			// lWidth
+			// 
+			this.lWidth.AutoSize = true;
+			this.lWidth.Location = new System.Drawing.Point(563, 350);
+			this.lWidth.Name = "lWidth";
+			this.lWidth.Size = new System.Drawing.Size(57, 16);
+			this.lWidth.TabIndex = 6;
+			this.lWidth.Text = "Width: 0";
+			// 
+			// lHeight
+			// 
+			this.lHeight.AutoSize = true;
+			this.lHeight.Location = new System.Drawing.Point(649, 350);
+			this.lHeight.Name = "lHeight";
+			this.lHeight.Size = new System.Drawing.Size(60, 16);
+			this.lHeight.TabIndex = 7;
+			this.lHeight.Text = "Height: 0";
+			// 
+			// lBpp
+			// 
+			this.lBpp.AutoSize = true;
+			this.lBpp.Location = new System.Drawing.Point(740, 350);
+			this.lBpp.Name = "lBpp";
+			this.lBpp.Size = new System.Drawing.Size(45, 16);
+			this.lBpp.TabIndex = 8;
+			this.lBpp.Text = "Bpp: 0";
+			// 
+			// lMetadataCount
+			// 
+			this.lMetadataCount.AutoSize = true;
+			this.lMetadataCount.Location = new System.Drawing.Point(809, 350);
+			this.lMetadataCount.Name = "lMetadataCount";
+			this.lMetadataCount.Size = new System.Drawing.Size(77, 16);
+			this.lMetadataCount.TabIndex = 9;
+			this.lMetadataCount.Text = "Metadata: 0";
+			// 
+			// bGreyscale
+			// 
+			this.bGreyscale.Location = new System.Drawing.Point(564, 121);
+			this.bGreyscale.Name = "bGreyscale";
+			this.bGreyscale.Size = new System.Drawing.Size(125, 28);
+			this.bGreyscale.TabIndex = 10;
+			this.bGreyscale.Text = "Conv to greyscale";
+			this.bGreyscale.UseVisualStyleBackColor = true;
+			this.bGreyscale.Click += new System.EventHandler(this.bGreyscale_Click);
+			// 
+			// cbSelectFrame
+			// 
+			this.cbSelectFrame.FormattingEnabled = true;
+			this.cbSelectFrame.Location = new System.Drawing.Point(695, 156);
+			this.cbSelectFrame.Name = "cbSelectFrame";
+			this.cbSelectFrame.Size = new System.Drawing.Size(121, 24);
+			this.cbSelectFrame.TabIndex = 11;
+			this.cbSelectFrame.SelectedIndexChanged += new System.EventHandler(this.comboBox1_SelectedIndexChanged);
+			// 
+			// lComment
+			// 
+			this.lComment.AutoSize = true;
+			this.lComment.Location = new System.Drawing.Point(563, 373);
+			this.lComment.Name = "lComment";
+			this.lComment.Size = new System.Drawing.Size(107, 16);
+			this.lComment.TabIndex = 12;
+			this.lComment.Text = "Image-comment:";
+			// 
+			// bAdjustGamma
+			// 
+			this.bAdjustGamma.Location = new System.Drawing.Point(564, 185);
+			this.bAdjustGamma.Name = "bAdjustGamma";
+			this.bAdjustGamma.Size = new System.Drawing.Size(125, 28);
+			this.bAdjustGamma.TabIndex = 13;
+			this.bAdjustGamma.Text = "Adjust gamma";
+			this.bAdjustGamma.UseVisualStyleBackColor = true;
+			this.bAdjustGamma.Click += new System.EventHandler(this.bAdjustGamma_Click);
+			// 
+			// vGamma
+			// 
+			this.vGamma.DecimalPlaces = 2;
+			this.vGamma.Increment = new decimal(new int[] {
+            0,
+            0,
+            0,
+            0});
+			this.vGamma.Location = new System.Drawing.Point(695, 189);
+			this.vGamma.Maximum = new decimal(new int[] {
+            2,
+            0,
+            0,
+            0});
+			this.vGamma.Name = "vGamma";
+			this.vGamma.Size = new System.Drawing.Size(121, 23);
+			this.vGamma.TabIndex = 14;
+			// 
+			// bRedChannelOnly
+			// 
+			this.bRedChannelOnly.Location = new System.Drawing.Point(564, 219);
+			this.bRedChannelOnly.Name = "bRedChannelOnly";
+			this.bRedChannelOnly.Size = new System.Drawing.Size(125, 28);
+			this.bRedChannelOnly.TabIndex = 15;
+			this.bRedChannelOnly.Text = "Red channel";
+			this.bRedChannelOnly.UseVisualStyleBackColor = true;
+			this.bRedChannelOnly.Click += new System.EventHandler(this.bRedChannelOnly_Click);
+			// 
+			// bBlueChannel
+			// 
+			this.bBlueChannel.Location = new System.Drawing.Point(564, 287);
+			this.bBlueChannel.Name = "bBlueChannel";
+			this.bBlueChannel.Size = new System.Drawing.Size(125, 28);
+			this.bBlueChannel.TabIndex = 16;
+			this.bBlueChannel.Text = "Blue channel";
+			this.bBlueChannel.UseVisualStyleBackColor = true;
+			this.bBlueChannel.Click += new System.EventHandler(this.bBlueChannel_Click);
+			// 
+			// bGreenChannel
+			// 
+			this.bGreenChannel.Location = new System.Drawing.Point(564, 253);
+			this.bGreenChannel.Name = "bGreenChannel";
+			this.bGreenChannel.Size = new System.Drawing.Size(125, 28);
+			this.bGreenChannel.TabIndex = 17;
+			this.bGreenChannel.Text = "Green channel";
+			this.bGreenChannel.UseVisualStyleBackColor = true;
+			this.bGreenChannel.Click += new System.EventHandler(this.bGreenChannel_Click);
+			// 
+			// bAllChannels
+			// 
+			this.bAllChannels.Location = new System.Drawing.Point(563, 321);
+			this.bAllChannels.Name = "bAllChannels";
+			this.bAllChannels.Size = new System.Drawing.Size(126, 28);
+			this.bAllChannels.TabIndex = 18;
+			this.bAllChannels.Text = "All channels";
+			this.bAllChannels.UseVisualStyleBackColor = true;
+			this.bAllChannels.Click += new System.EventHandler(this.bAllChannels_Click);
+			// 
+			// lSelectFrame
+			// 
+			this.lSelectFrame.AutoSize = true;
+			this.lSelectFrame.Location = new System.Drawing.Point(563, 159);
+			this.lSelectFrame.Name = "lSelectFrame";
+			this.lSelectFrame.Size = new System.Drawing.Size(86, 16);
+			this.lSelectFrame.TabIndex = 19;
+			this.lSelectFrame.Text = "Select frame:";
+			// 
+			// lImageFormat
+			// 
+			this.lImageFormat.AutoSize = true;
+			this.lImageFormat.Location = new System.Drawing.Point(563, 395);
+			this.lImageFormat.Name = "lImageFormat";
+			this.lImageFormat.Size = new System.Drawing.Size(92, 16);
+			this.lImageFormat.TabIndex = 20;
+			this.lImageFormat.Text = "Image-format:";
+			// 
+			// bRotate
+			// 
+			this.bRotate.Location = new System.Drawing.Point(564, 86);
+			this.bRotate.Name = "bRotate";
+			this.bRotate.Size = new System.Drawing.Size(125, 28);
+			this.bRotate.TabIndex = 21;
+			this.bRotate.Text = "Rotate";
+			this.bRotate.UseVisualStyleBackColor = true;
+			this.bRotate.Click += new System.EventHandler(this.bRotate_Click);
+			// 
+			// vRotate
+			// 
+			this.vRotate.Location = new System.Drawing.Point(695, 80);
+			this.vRotate.Maximum = 360;
+			this.vRotate.Name = "vRotate";
+			this.vRotate.Size = new System.Drawing.Size(170, 45);
+			this.vRotate.TabIndex = 22;
+			this.vRotate.TickFrequency = 10;
+			this.vRotate.TickStyle = System.Windows.Forms.TickStyle.Both;
+			this.vRotate.Scroll += new System.EventHandler(this.vRotate_Scroll);
+			// 
+			// lRotate
+			// 
+			this.lRotate.AutoSize = true;
+			this.lRotate.Location = new System.Drawing.Point(871, 92);
+			this.lRotate.Name = "lRotate";
+			this.lRotate.Size = new System.Drawing.Size(15, 16);
+			this.lRotate.TabIndex = 23;
+			this.lRotate.Text = "0";
+			// 
+			// lColors
+			// 
+			this.lColors.AutoSize = true;
+			this.lColors.Location = new System.Drawing.Point(740, 394);
+			this.lColors.Name = "lColors";
+			this.lColors.Size = new System.Drawing.Size(60, 16);
+			this.lColors.TabIndex = 24;
+			this.lColors.Text = "Colors: 0";
+			// 
+			// nShowMetadata
+			// 
+			this.nShowMetadata.Location = new System.Drawing.Point(696, 15);
+			this.nShowMetadata.Name = "nShowMetadata";
+			this.nShowMetadata.Size = new System.Drawing.Size(125, 28);
+			this.nShowMetadata.TabIndex = 25;
+			this.nShowMetadata.Text = "Show metadata";
+			this.nShowMetadata.UseVisualStyleBackColor = true;
+			this.nShowMetadata.Click += new System.EventHandler(this.nShowMetadata_Click);
+			// 
+			// MainForm
+			// 
+			this.AutoScaleDimensions = new System.Drawing.SizeF(7F, 16F);
+			this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
+			this.ClientSize = new System.Drawing.Size(908, 423);
+			this.Controls.Add(this.nShowMetadata);
+			this.Controls.Add(this.lColors);
+			this.Controls.Add(this.lRotate);
+			this.Controls.Add(this.vRotate);
+			this.Controls.Add(this.bRotate);
+			this.Controls.Add(this.lImageFormat);
+			this.Controls.Add(this.lSelectFrame);
+			this.Controls.Add(this.bAllChannels);
+			this.Controls.Add(this.bGreenChannel);
+			this.Controls.Add(this.bBlueChannel);
+			this.Controls.Add(this.bRedChannelOnly);
+			this.Controls.Add(this.vGamma);
+			this.Controls.Add(this.bAdjustGamma);
+			this.Controls.Add(this.lComment);
+			this.Controls.Add(this.cbSelectFrame);
+			this.Controls.Add(this.bGreyscale);
+			this.Controls.Add(this.lMetadataCount);
+			this.Controls.Add(this.lBpp);
+			this.Controls.Add(this.lHeight);
+			this.Controls.Add(this.lWidth);
+			this.Controls.Add(this.bSaveImage);
+			this.Controls.Add(this.bLoadImage);
+			this.Controls.Add(this.pictureBox);
+			this.DoubleBuffered = true;
+			this.Font = new System.Drawing.Font("Tahoma", 9.75F, System.Drawing.FontStyle.Regular, System.Drawing.GraphicsUnit.Point, ((byte)(0)));
+			this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
+			this.Margin = new System.Windows.Forms.Padding(4);
+			this.MaximizeBox = false;
+			this.MinimizeBox = false;
+			this.Name = "MainForm";
+			this.StartPosition = System.Windows.Forms.FormStartPosition.CenterScreen;
+			this.Text = "Sample 11";
+			((System.ComponentModel.ISupportInitialize)(this.pictureBox)).EndInit();
+			((System.ComponentModel.ISupportInitialize)(this.vGamma)).EndInit();
+			((System.ComponentModel.ISupportInitialize)(this.vRotate)).EndInit();
+			this.ResumeLayout(false);
+			this.PerformLayout();
+
+		}
+
+		#endregion
+
+		private System.Windows.Forms.PictureBox pictureBox;
+		private System.Windows.Forms.Button bLoadImage;
+		private System.Windows.Forms.Button bSaveImage;
+		private System.Windows.Forms.OpenFileDialog ofd;
+		private System.Windows.Forms.SaveFileDialog sfd;
+		private System.Windows.Forms.Label lWidth;
+		private System.Windows.Forms.Label lHeight;
+		private System.Windows.Forms.Label lBpp;
+		private System.Windows.Forms.Label lMetadataCount;
+		private System.Windows.Forms.Button bGreyscale;
+		private System.Windows.Forms.ComboBox cbSelectFrame;
+		private System.Windows.Forms.Label lComment;
+		private System.Windows.Forms.Button bAdjustGamma;
+		private System.Windows.Forms.NumericUpDown vGamma;
+		private System.Windows.Forms.Button bRedChannelOnly;
+		private System.Windows.Forms.Button bBlueChannel;
+		private System.Windows.Forms.Button bGreenChannel;
+		private System.Windows.Forms.Button bAllChannels;
+		private System.Windows.Forms.Label lSelectFrame;
+		private System.Windows.Forms.Label lImageFormat;
+		private System.Windows.Forms.Button bRotate;
+		private System.Windows.Forms.TrackBar vRotate;
+		private System.Windows.Forms.Label lRotate;
+		private System.Windows.Forms.Label lColors;
+		private System.Windows.Forms.Button nShowMetadata;
+	}
+}
+
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,412 @@
+using System;
+using System.Collections.Generic;
+using System.ComponentModel;
+using System.Drawing;
+using System.Windows.Forms;
+using FreeImageAPI;
+using FreeImageAPI.Metadata;
+using FreeImageAPI.Plugins;
+
+namespace Sample11
+{
+	public partial class MainForm : Form
+	{
+		public MainForm()
+		{
+			InitializeComponent();
+		}
+
+		[STAThread]
+		static void Main()
+		{
+			// Capture messages generated by FreeImage
+			FreeImageEngine.Message += new OutputMessageFunction(FreeImageEngine_Message);
+
+			Application.EnableVisualStyles();
+			Application.SetCompatibleTextRenderingDefault(false);
+			Application.Run(new MainForm());
+		}
+
+		static void FreeImageEngine_Message(FREE_IMAGE_FORMAT fif, string message)
+		{
+			// Display the message
+			// FreeImage continues code executing when all
+			// addes subscribers of 'Message' finished returned.
+			MessageBox.Show(message, "FreeImage-Message", MessageBoxButtons.OK, MessageBoxIcon.Information);
+		}
+
+		// The FreeImageBitmap this sample will work with.
+		FreeImageBitmap bitmap = null;
+
+		// Replaces the current bitmap with the given one.
+		private void ReplaceBitmap(FreeImageBitmap newBitmap)
+		{
+			// Checks whether the bitmap is usable
+			if (newBitmap == null || newBitmap.IsDisposed)
+			{
+				MessageBox.Show(
+					"Unexpected error.",
+					"Error",
+					MessageBoxButtons.OK,
+					MessageBoxIcon.Error);
+			}
+
+			// Check whether the image type of the new bitmap is 'FIT_BITMAP'.
+			// If not convert to 'FIT_BITMAP'.
+			if (newBitmap.ImageType != FREE_IMAGE_TYPE.FIT_BITMAP)
+			{
+				if (!newBitmap.ConvertType(FREE_IMAGE_TYPE.FIT_BITMAP, true))
+				{
+					MessageBox.Show(
+						"Error converting bitmap to standard type.",
+						"Error",
+						MessageBoxButtons.OK,
+						MessageBoxIcon.Error);
+					return;
+				}
+			}
+
+			// Dispose the old bitmap only in case it exists and
+			// the old instance is another than the new one.
+			if ((bitmap != null) && !object.ReferenceEquals(bitmap, newBitmap))
+			{
+				bitmap.Dispose();
+			}
+			// Dispose the picturebox's bitmap in case it exists.
+			if (pictureBox.Image != null)
+			{
+				pictureBox.Image.Dispose();
+			}
+
+			// Set the new bitmap.
+			pictureBox.Image = (Bitmap)(bitmap = newBitmap);
+
+			// Update gui.
+			UpdateBitmapInformations();
+			UpdateFrameSelection();
+		}
+
+		// Get bitmap properties and display them in the gui.
+		private void UpdateBitmapInformations()
+		{
+			if (Bitmap)
+			{
+				// Get width
+				lWidth.Text = String.Format("Width: {0}", bitmap.Width);
+				// Get Height
+				lHeight.Text = String.Format("Height: {0}", bitmap.Height);
+				// Get color depth
+				lBpp.Text = String.Format("Bpp: {0}", bitmap.ColorDepth);
+				// Get number of metadata
+				ImageMetadata mData = bitmap.Metadata;
+				mData.HideEmptyModels = true;
+				int mCnt = 0;
+				foreach (MetadataModel model in mData.List)
+				{
+					mCnt += model.Count;
+				}
+				lMetadataCount.Text = String.Format("Metadata: {0}", mCnt);
+				// Get image comment
+				lComment.Text = String.Format("Image-comment: {0}", bitmap.Comment != null ? bitmap.Comment : String.Empty);
+				// Get the number of real colors in the image
+				lColors.Text = String.Format("Colors: {0}", bitmap.UniqueColors);
+			}
+			else
+			{
+				// Reset all values
+				lWidth.Text = String.Format("Width: {0}", 0);
+				lHeight.Text = String.Format("Height: {0}", 0);
+				lBpp.Text = String.Format("Bpp: {0}", 0);
+				lMetadataCount.Text = String.Format("Metadata: {0}", 0);
+				lComment.Text = String.Format("Image-comment: {0}", String.Empty);
+				lColors.Text = String.Format("Colors: {0}", 0);
+			}
+		}
+
+		// Update combobox for frame selection.
+		private void UpdateFrameSelection()
+		{
+			cbSelectFrame.Items.Clear();
+			if (Bitmap)
+			{
+				// Get number of frames in the bitmap
+				if (bitmap.FrameCount > 1)
+				{
+					// Add an entry for each frame to the combobox
+					for (int i = 0; i < bitmap.FrameCount; i++)
+					{
+						cbSelectFrame.Items.Add(String.Format("Frame {0}", i + 1));
+					}
+				}
+			}
+		}
+
+		// Returns true in case the variable 'bitmap'
+		// is set and not disposed.
+		private bool Bitmap
+		{
+			get { return ((bitmap != null) && (!bitmap.IsDisposed)); }
+		}
+
+		private void bLoadImage_Click(object sender, EventArgs e)
+		{
+			if (ofd.ShowDialog() == DialogResult.OK)
+			{
+				try
+				{
+					// Load the file using autodetection
+					FreeImageBitmap fib = new FreeImageBitmap(ofd.FileName);
+					// Rescale the image so that it fits the picturebox
+					// Get the plugin that was used to load the bitmap
+					FreeImagePlugin plug = PluginRepository.Plugin(fib.ImageFormat);
+					lImageFormat.Text = String.Format("Image-format: {0}", plug.Format);
+					// Replace the existing bitmap with the new one
+					ReplaceBitmap(fib);
+				}
+				catch
+				{
+				}
+			}
+		}
+
+		private void bSaveImage_Click(object sender, EventArgs e)
+		{
+			if (pictureBox.Image != null)
+			{
+				try
+				{
+					if (sfd.ShowDialog() == DialogResult.OK)
+					{
+						// Save the bitmap using autodetection
+						using (FreeImageBitmap temp = new FreeImageBitmap(pictureBox.Image))
+						{
+							temp.Save(sfd.FileName);
+						}
+					}
+				}
+				catch
+				{
+				}
+			}
+		}
+
+		private void bRotate_Click(object sender, EventArgs e)
+		{
+			if (Bitmap)
+			{
+				// Create a temporary rescaled bitmap
+				using (FreeImageBitmap temp = bitmap.GetScaledInstance(
+					pictureBox.DisplayRectangle.Width, pictureBox.DisplayRectangle.Height,
+					FREE_IMAGE_FILTER.FILTER_CATMULLROM))
+				{
+					if (temp != null)
+					{
+						// Rotate the bitmap
+						temp.Rotate((double)vRotate.Value);
+						if (pictureBox.Image != null)
+						{
+							pictureBox.Image.Dispose();
+						}
+						// Display the result
+						pictureBox.Image = (Bitmap)temp;
+					}
+				}
+			}
+		}
+
+		private void bGreyscale_Click(object sender, EventArgs e)
+		{
+			if (Bitmap)
+			{
+				// Convert the bitmap to 8bpp and greyscale
+				ReplaceBitmap(bitmap.GetColorConvertedInstance(
+					FREE_IMAGE_COLOR_DEPTH.FICD_08_BPP |
+					FREE_IMAGE_COLOR_DEPTH.FICD_FORCE_GREYSCALE));
+			}
+		}
+
+		private void comboBox1_SelectedIndexChanged(object sender, EventArgs e)
+		{
+			ComboBox cb = sender as ComboBox;
+			if ((cb != null) && (cb.Items.Count > 0))
+			{
+				if (Bitmap)
+				{
+					try
+					{
+						// Switch the selected frame
+						bitmap.SelectActiveFrame(cb.SelectedIndex);
+						ReplaceBitmap(bitmap);
+					}
+					catch (ArgumentOutOfRangeException)
+					{
+						MessageBox.Show("Error changing frame.", "Error");
+					}
+				}
+			}
+		}
+
+		private void bAdjustGamma_Click(object sender, EventArgs e)
+		{
+			if (Bitmap)
+			{
+				// Adjust the gamma value
+				bitmap.AdjustGamma((double)vGamma.Value);
+				ReplaceBitmap(bitmap);
+			}
+		}
+
+		private void bRedChannelOnly_Click(object sender, EventArgs e)
+		{
+			// Mask out green and blue
+			SetColorChannels(0xFF, 0x00, 0x00);
+		}
+
+		private void bGreenChannel_Click(object sender, EventArgs e)
+		{
+			// Mask out red and blue
+			SetColorChannels(0x00, 0xFF, 0x00);
+		}
+
+		private void bBlueChannel_Click(object sender, EventArgs e)
+		{
+			// Mask out red and green
+			SetColorChannels(0x00, 0x00, 0xFF);
+		}
+
+		private void bAllChannels_Click(object sender, EventArgs e)
+		{
+			if (Bitmap)
+			{
+				// Restore the bitmap using the original
+				ReplaceBitmap(bitmap);
+			}
+		}
+
+		private void SetColorChannels(int redmask, int greenmask, int bluemask)
+		{
+			if (Bitmap)
+			{
+				// Create a temporary clone.
+				using (FreeImageBitmap bitmap = (FreeImageBitmap)this.bitmap.Clone())
+				{
+					if (bitmap != null)
+					{
+						// Check whether the bitmap has a palette
+						if (bitmap.HasPalette)
+						{
+							// Use the Palette class to handle the bitmap's
+							// palette. A palette always consist of RGBQUADs.
+							Palette palette = bitmap.Palette;
+							// Apply the new values for all three color components.
+							for (int i = 0; i < palette.Length; i++)
+							{
+								RGBQUAD rgbq = palette[i];
+
+								rgbq.rgbRed = (byte)(rgbq.rgbRed & redmask);
+								rgbq.rgbGreen = (byte)(rgbq.rgbGreen & greenmask);
+								rgbq.rgbBlue = (byte)(rgbq.rgbBlue & bluemask);
+
+								palette[i] = rgbq;
+							}
+						}
+						// In case the bitmap has no palette it must have a color depth
+						// of 16, 24 or 32. Each color depth needs a different wrapping
+						// structure for the bitmaps data. These structures can be accessed
+						// by using the foreach clause.
+						else if (bitmap.ColorDepth == 16)
+						{
+							// Iterate over each scanline
+							// For 16bpp use either Scanline<FI16RGB555> or Scanline<FI16RGB565>
+							if (bitmap.IsRGB555)
+							{
+								foreach (Scanline<FI16RGB555> scanline in bitmap)
+								{
+									for (int x = 0; x < scanline.Length; x++)
+									{
+										FI16RGB555 pixel = scanline[x];
+										pixel.Red = (byte)(pixel.Red & redmask);
+										pixel.Green = (byte)(pixel.Green & greenmask);
+										pixel.Blue = (byte)(pixel.Blue & bluemask);
+										scanline[x] = pixel;
+									}
+								}
+							}
+							else if (bitmap.IsRGB565)
+							{
+								foreach (Scanline<FI16RGB565> scanline in bitmap)
+								{
+									for (int x = 0; x < scanline.Length; x++)
+									{
+										FI16RGB565 pixel = scanline[x];
+										pixel.Red = (byte)(pixel.Red & redmask);
+										pixel.Green = (byte)(pixel.Green & greenmask);
+										pixel.Blue = (byte)(pixel.Blue & bluemask);
+										scanline[x] = pixel;
+									}
+								}
+							}
+						}
+						else if (bitmap.ColorDepth == 24)
+						{
+							// Iterate over each scanline
+							// For 24bpp Scanline<RGBTRIPLE> must be used
+							foreach (Scanline<RGBTRIPLE> scanline in bitmap)
+							{
+								for (int x = 0; x < scanline.Length; x++)
+								{
+									RGBTRIPLE pixel = scanline[x];
+									pixel.rgbtRed = (byte)(pixel.rgbtRed & redmask);
+									pixel.rgbtGreen = (byte)(pixel.rgbtGreen & greenmask);
+									pixel.rgbtBlue = (byte)(pixel.rgbtBlue & bluemask);
+									scanline[x] = pixel;
+								}
+							}
+						}
+						else if (bitmap.ColorDepth == 32)
+						{
+							// Iterate over each scanline
+							// For 32bpp Scanline<RGBQUAD> must be used
+							foreach (Scanline<RGBQUAD> scanline in bitmap)
+							{
+								for (int x = 0; x < scanline.Length; x++)
+								{
+									RGBQUAD pixel = scanline[x];
+									pixel.rgbRed = (byte)(pixel.rgbRed & redmask);
+									pixel.rgbGreen = (byte)(pixel.rgbGreen & greenmask);
+									pixel.rgbBlue = (byte)(pixel.rgbBlue & bluemask);
+									scanline[x] = pixel;
+								}
+							}
+						}
+						// Dispose only the picturebox's bitmap
+						if (pictureBox.Image != null)
+						{
+							pictureBox.Image.Dispose();
+						}
+						pictureBox.Image = (Bitmap)bitmap;
+					}
+				}
+			}
+		}
+
+		private void vRotate_Scroll(object sender, EventArgs e)
+		{
+			TrackBar bar = sender as TrackBar;
+			if (bar != null)
+			{
+				lRotate.Text = bar.Value.ToString();
+			}
+		}
+
+		private void nShowMetadata_Click(object sender, EventArgs e)
+		{
+			if (Bitmap)
+			{
+				MetaDataFrame mFrame = new MetaDataFrame();
+				mFrame.Tag = bitmap.Metadata;
+				mFrame.ShowDialog(this);
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,126 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <!-- 
+    Microsoft ResX Schema 
+    
+    Version 2.0
+    
+    The primary goals of this format is to allow a simple XML format 
+    that is mostly human readable. The generation and parsing of the 
+    various data types are done through the TypeConverter classes 
+    associated with the data types.
+    
+    Example:
+    
+    ... ado.net/XML headers & schema ...
+    <resheader name="resmimetype">text/microsoft-resx</resheader>
+    <resheader name="version">2.0</resheader>
+    <resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
+    <resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
+    <data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
+    <data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
+    <data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
+        <value>[base64 mime encoded serialized .NET Framework object]</value>
+    </data>
+    <data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
+        <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
+        <comment>This is a comment</comment>
+    </data>
+                
+    There are any number of "resheader" rows that contain simple 
+    name/value pairs.
+    
+    Each data row contains a name, and value. The row also contains a 
+    type or mimetype. Type corresponds to a .NET class that support 
+    text/value conversion through the TypeConverter architecture. 
+    Classes that don't support this are serialized and stored with the 
+    mimetype set.
+    
+    The mimetype is used for serialized objects, and tells the 
+    ResXResourceReader how to depersist the object. This is currently not 
+    extensible. For a given mimetype the value must be set accordingly:
+    
+    Note - application/x-microsoft.net.object.binary.base64 is the format 
+    that the ResXResourceWriter will generate, however the reader can 
+    read any of the formats listed below.
+    
+    mimetype: application/x-microsoft.net.object.binary.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
+            : and then encoded with base64 encoding.
+    
+    mimetype: application/x-microsoft.net.object.soap.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
+            : and then encoded with base64 encoding.
+
+    mimetype: application/x-microsoft.net.object.bytearray.base64
+    value   : The object must be serialized into a byte array 
+            : using a System.ComponentModel.TypeConverter
+            : and then encoded with base64 encoding.
+    -->
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
+              <xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
+              <xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <metadata name="ofd.TrayLocation" type="System.Drawing.Point, System.Drawing, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b03f5f7f11d50a3a">
+    <value>17, 17</value>
+  </metadata>
+  <metadata name="sfd.TrayLocation" type="System.Drawing.Point, System.Drawing, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b03f5f7f11d50a3a">
+    <value>84, 17</value>
+  </metadata>
+</root>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,63 @@
+namespace Sample11
+{
+	partial class MetaDataFrame
+	{
+		/// <summary>
+		/// Erforderliche Designervariable.
+		/// </summary>
+		private System.ComponentModel.IContainer components = null;
+
+		/// <summary>
+		/// Verwendete Ressourcen bereinigen.
+		/// </summary>
+		/// <param name="disposing">True, wenn verwaltete Ressourcen gelöscht werden sollen; andernfalls False.</param>
+		protected override void Dispose(bool disposing)
+		{
+			if (disposing && (components != null))
+			{
+				components.Dispose();
+			}
+			base.Dispose(disposing);
+		}
+
+		#region Vom Windows Form-Designer generierter Code
+
+		/// <summary>
+		/// Erforderliche Methode für die Designerunterstützung.
+		/// Der Inhalt der Methode darf nicht mit dem Code-Editor geändert werden.
+		/// </summary>
+		private void InitializeComponent()
+		{
+			this.tvMetadata = new System.Windows.Forms.TreeView();
+			this.SuspendLayout();
+			// 
+			// tvMetadata
+			// 
+			this.tvMetadata.Location = new System.Drawing.Point(12, 12);
+			this.tvMetadata.Name = "tvMetadata";
+			this.tvMetadata.Size = new System.Drawing.Size(389, 318);
+			this.tvMetadata.TabIndex = 3;
+			// 
+			// MetaDataFrame
+			// 
+			this.AutoScaleDimensions = new System.Drawing.SizeF(6F, 13F);
+			this.AutoScaleMode = System.Windows.Forms.AutoScaleMode.Font;
+			this.ClientSize = new System.Drawing.Size(417, 349);
+			this.Controls.Add(this.tvMetadata);
+			this.DoubleBuffered = true;
+			this.FormBorderStyle = System.Windows.Forms.FormBorderStyle.FixedDialog;
+			this.MaximizeBox = false;
+			this.MinimizeBox = false;
+			this.Name = "MetaDataFrame";
+			this.StartPosition = System.Windows.Forms.FormStartPosition.CenterParent;
+			this.Text = "Metadata";
+			this.Load += new System.EventHandler(this.MetaDataFrame_Load);
+			this.ResumeLayout(false);
+
+		}
+
+		#endregion
+
+		private System.Windows.Forms.TreeView tvMetadata;
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,49 @@
+using System;
+using System.ComponentModel;
+using System.Windows.Forms;
+using FreeImageAPI;
+using FreeImageAPI.Metadata;
+
+namespace Sample11
+{
+	public partial class MetaDataFrame : Form
+	{
+		public MetaDataFrame()
+		{
+			InitializeComponent();
+		}
+
+		private void MetaDataFrame_Load(object sender, EventArgs e)
+		{
+			ImageMetadata iMetadata = this.Tag as ImageMetadata;
+			if (iMetadata != null)
+			{
+				bool backup = iMetadata.HideEmptyModels;
+				iMetadata.HideEmptyModels = false;
+				try
+				{
+					// Get each metadata model
+					foreach (MetadataModel metadataModel in iMetadata)
+					{
+						// Create a new node for each model
+						TreeNode modelNode = tvMetadata.Nodes.Add(metadataModel.ToString());
+
+						// Get each metadata tag and create a subnode for it
+						foreach (MetadataTag metadataTag in metadataModel)
+						{
+							modelNode.Nodes.Add(metadataTag.Key + ": " + metadataTag.ToString());
+						}
+					}
+				}
+				// Display error message
+				catch (Exception ex)
+				{
+					while (ex.InnerException != null)
+						ex = ex.InnerException;
+					MessageBox.Show(ex.ToString(), "Exception caught");
+				}
+				iMetadata.HideEmptyModels = backup;
+			}
+		}
+	}
+}
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,120 @@
+<?xml version="1.0" encoding="utf-8"?>
+<root>
+  <!-- 
+    Microsoft ResX Schema 
+    
+    Version 2.0
+    
+    The primary goals of this format is to allow a simple XML format 
+    that is mostly human readable. The generation and parsing of the 
+    various data types are done through the TypeConverter classes 
+    associated with the data types.
+    
+    Example:
+    
+    ... ado.net/XML headers & schema ...
+    <resheader name="resmimetype">text/microsoft-resx</resheader>
+    <resheader name="version">2.0</resheader>
+    <resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
+    <resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
+    <data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
+    <data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
+    <data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
+        <value>[base64 mime encoded serialized .NET Framework object]</value>
+    </data>
+    <data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
+        <value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
+        <comment>This is a comment</comment>
+    </data>
+                
+    There are any number of "resheader" rows that contain simple 
+    name/value pairs.
+    
+    Each data row contains a name, and value. The row also contains a 
+    type or mimetype. Type corresponds to a .NET class that support 
+    text/value conversion through the TypeConverter architecture. 
+    Classes that don't support this are serialized and stored with the 
+    mimetype set.
+    
+    The mimetype is used for serialized objects, and tells the 
+    ResXResourceReader how to depersist the object. This is currently not 
+    extensible. For a given mimetype the value must be set accordingly:
+    
+    Note - application/x-microsoft.net.object.binary.base64 is the format 
+    that the ResXResourceWriter will generate, however the reader can 
+    read any of the formats listed below.
+    
+    mimetype: application/x-microsoft.net.object.binary.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
+            : and then encoded with base64 encoding.
+    
+    mimetype: application/x-microsoft.net.object.soap.base64
+    value   : The object must be serialized with 
+            : System.Runtime.Serialization.Formatters.Soap.SoapFormatter
+            : and then encoded with base64 encoding.
+
+    mimetype: application/x-microsoft.net.object.bytearray.base64
+    value   : The object must be serialized into a byte array 
+            : using a System.ComponentModel.TypeConverter
+            : and then encoded with base64 encoding.
+    -->
+  <xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
+    <xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
+    <xsd:element name="root" msdata:IsDataSet="true">
+      <xsd:complexType>
+        <xsd:choice maxOccurs="unbounded">
+          <xsd:element name="metadata">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" />
+              </xsd:sequence>
+              <xsd:attribute name="name" use="required" type="xsd:string" />
+              <xsd:attribute name="type" type="xsd:string" />
+              <xsd:attribute name="mimetype" type="xsd:string" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="assembly">
+            <xsd:complexType>
+              <xsd:attribute name="alias" type="xsd:string" />
+              <xsd:attribute name="name" type="xsd:string" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="data">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+                <xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
+              <xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
+              <xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
+              <xsd:attribute ref="xml:space" />
+            </xsd:complexType>
+          </xsd:element>
+          <xsd:element name="resheader">
+            <xsd:complexType>
+              <xsd:sequence>
+                <xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
+              </xsd:sequence>
+              <xsd:attribute name="name" type="xsd:string" use="required" />
+            </xsd:complexType>
+          </xsd:element>
+        </xsd:choice>
+      </xsd:complexType>
+    </xsd:element>
+  </xsd:schema>
+  <resheader name="resmimetype">
+    <value>text/microsoft-resx</value>
+  </resheader>
+  <resheader name="version">
+    <value>2.0</value>
+  </resheader>
+  <resheader name="reader">
+    <value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+  <resheader name="writer">
+    <value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
+  </resheader>
+</root>
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,16 @@
+using System.Reflection;
+using System.Runtime.CompilerServices;
+using System.Runtime.InteropServices;
+
+[assembly: AssemblyTitle("")]
+[assembly: AssemblyDescription("")]
+[assembly: AssemblyConfiguration("")]
+[assembly: AssemblyCompany("")]
+[assembly: AssemblyProduct("")]
+[assembly: AssemblyCopyright("")]
+[assembly: AssemblyTrademark("")]
+[assembly: AssemblyCulture("")]
+[assembly: ComVisible(false)]
+[assembly: Guid("219019e1-9a57-46c7-b9d7-3928a9277fd6")]
+[assembly: AssemblyVersion("1.0.0.0")]
+[assembly: AssemblyFileVersion("1.0.0.0")]
--- a/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
+++ b/DSTexCompress/FreeImage/Wrapper/FreeImage.NET/cs/Samples/Sample
@@ -0,0 +1,113 @@
+<Project DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
+  <PropertyGroup>
+    <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration>
+    <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform>
+    <ProductVersion>8.0.50727</ProductVersion>
+    <SchemaVersion>2.0</SchemaVersion>
+    <ProjectGuid>{996068CD-D07A-42E0-856F-ACC71E8565EF}</ProjectGuid>
+    <OutputType>WinExe</OutputType>
+    <AppDesignerFolder>Properties</AppDesignerFolder>
+    <RootNamespace>Sample11</RootNamespace>
+    <AssemblyName>Sample11</AssemblyName>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
+    <DebugSymbols>true</DebugSymbols>
+    <DebugType>full</DebugType>
+    <Optimize>false</Optimize>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <ErrorReport>none</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <FileAlignment>512</FileAlignment>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
+    <DebugType>none</DebugType>
+    <Optimize>true</Optimize>
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <ErrorReport>none</ErrorReport>
+    <WarningLevel>4</WarningLevel>
+    <FileAlignment>512</FileAlignment>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x86' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <FileAlignment>512</FileAlignment>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>none</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x86' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <FileAlignment>512</FileAlignment>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x86</PlatformTarget>
+    <ErrorReport>none</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|x64' ">
+    <DebugSymbols>true</DebugSymbols>
+    <OutputPath>bin\Debug\</OutputPath>
+    <DefineConstants>DEBUG;TRACE</DefineConstants>
+    <FileAlignment>512</FileAlignment>
+    <DebugType>full</DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <UseVSHostingProcess>false</UseVSHostingProcess>
+    <ErrorReport>none</ErrorReport>
+  </PropertyGroup>
+  <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|x64' ">
+    <OutputPath>bin\Release\</OutputPath>
+    <DefineConstants>TRACE</DefineConstants>
+    <Optimize>true</Optimize>
+    <FileAlignment>512</FileAlignment>
+    <DebugType>
+    </DebugType>
+    <PlatformTarget>x64</PlatformTarget>
+    <ErrorReport>none</ErrorReport>
+  </PropertyGroup>
+  <ItemGroup>
+    <Reference Include="FreeImageNET, Version=3.11.0.0, Culture=neutral, processorArchitecture=MSIL">
+      <SpecificVersion>False</SpecificVersion>
+      <HintPath>..\..\Bin\FreeImageNET.dll</HintPath>
+    </Reference>
+    <Reference Include="System" />
+    <Reference Include="System.Drawing" />
+    <Reference Include="System.Windows.Forms" />
+  </ItemGroup>
+  <ItemGroup>
+    <Compile Include="MainForm.cs">
+      <SubType>Form</SubType>
+    </Compile>
+    <Compile Include="MainForm.Designer.cs">
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </Compile>
+    <Compile Include="MetaDataFrame.cs">
+      <SubType>Form</SubType>
+    </Compile>
+    <Compile Include="MetaDataFrame.Designer.cs">
+      <DependentUpon>MetaDataFrame.cs</DependentUpon>
+    </Compile>
+    <Compile Include="Properties\AssemblyInfo.cs" />
+    <EmbeddedResource Include="MainForm.resx">
+      <SubType>Designer</SubType>
+      <DependentUpon>MainForm.cs</DependentUpon>
+    </EmbeddedResource>
+    <EmbeddedResource Include="MetaDataFrame.resx">
+      <SubType>Designer</SubType>
+      <DependentUpon>MetaDataFrame.cs</DependentUpon>
+    </EmbeddedResource>
+  </ItemGroup>
+  <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" />
+  <!-- To modify your build process, add your task inside one of the targets below and uncomment it. 
+       Other similar extension points exist, see Microsoft.Common.targets.
+  <Target Name="BeforeBuild">
+  </Target>
+  <Target Name="AfterBuild">
+  </Target>
+  -->
+</Project>